
CAS Number207974-20-7
Synonyms1-[3-Fluoro-5-(trifluoromethyl)phenyl]propan-1-one; MFCD00061262; FXFFR CF EV2; 3′-Fluoro-5′-(trifluoromethyl)propiophenone; 1-[3-Fluoro-5-(trifluoromethyl)phenyl]-1-propanone; 3'-Fluoro-5'-(trifluoromethyl)propiophenone
Molecular FormulaFC6H3(CF3)CO2H
Molecular Weight208.11
Purity98%
Density1.3±0.1 g/cm3
Boiling Point202.1±35.0 °C at 760 mmHg
Melting Point104-108 °C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 207974-20-7 |
| Catalog No. | 2A-9081902 |
| Chinese Name | 3′-氟-5′-(三氟甲基)苯乙酮 |
| Synonyms | 1-[3-Fluoro-5-(trifluoromethyl)phenyl]propan-1-one; MFCD00061262; FXFFR CF EV2; 3′-Fluoro-5′-(trifluoromethyl)propiophenone; 1-[3-Fluoro-5-(trifluoromethyl)phenyl]-1-propanone; 3'-Fluoro-5'-(trifluoromethyl)propiophenone |
| Molecular Formula | FC6H3(CF3)CO2H |
| Molecular Weight | 208.11 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 202.1±35.0 °C at 760 mmHg |
| Melting Point | 104-108 °C (lit.) |
| Storage Condition | Storage method: airtight, in a cool, dry place |
| HTC | 2914700090 |
| PubChem ID | 24869055 |
| MDL Number | MFCD00061293 |
| SMILES | OC(=O)c1cc(F)cc(c1)C(F)(F)F |
| InChI | 1S/C8H4F4O2/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H,13,14) |
| InChI Key | NSGKIIGVPBTOBF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/81902_1_207974_20_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Chloro-5-(trifluoromethyl)anisole | 886497-07-0 | 2A-9081878 |
| 3-Fluoro-5-(trifluoromethyl)benzenesulphonylchloride | 886499-99-6 | 2A-9081886 |
| 4-(2,2,2-Trifluoroethoxy)phenylboronicacid | 886536-37-4 | 2A-9081889 |
| 4-(Trifluoromethylsulfinyl)chlorobenzene | 708-66-7 | 2A-9081896 |
| 4-(Trifluoromethyl)phthalicacid | 835-58-5 | 2A-9081898 |
| 2-Fluoro-5-(trifluoromethyl)propiophenone | 207974-18-3 | 2A-9081903 |
| 2-Fluoro-4-(trifluoromethyl)propiophenone | 208173-16-4 | 2A-9081904 |
| 2'-Fluoro-3'-(trifluoromethyl)propiophenone | 207986-23-0 | 2A-9081905 |
| 4-Trifluoromethylpropiophenone | 711-33-1 | 2A-9081906 |
| 5-[3,5-Bis(trifluoromethyl)phenyl]-2-furaldehyde | 256658-04-5 | 2A-9081908 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA