
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 886497-85-4 |
| Catalog No. | 2A-9081880 |
| Chinese Name | 2-氟-5-三氟甲氧基苯甲酸 |
| Synonyms | QVR BF EOXFFF; α,α,α,6-tetrafluoro-m-anisic acid; 2-Fluoro-5-(trifluoromethoxy)benzoic acid |
| Molecular Formula | C8H4F4O3 |
| Molecular Weight | 224.109 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 251.9±35.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | O=C(O)c1cc(OC(F)(F)F)ccc1F |
| InChI Key | CSMVUVGPLMTFIZ-UHFFFAOYSA-N |
| MSDS | msds/81880_1_886497_85_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Trifluoroacetyl-3-methyl-1-phenyl-5-pyrazolone | 1691-93-6 | 2A-9081842 |
| (5-Bromopyrimidin-2-yl)phenylamine | 886365-88-4 | 2A-9081856 |
| 4-Bromo-6-MethylNicotinicacidmethylester | 886372-03-8 | 2A-9081873 |
| 4-Chloro-6-MethylNicotinicacidmethylester | 886372-05-0 | 2A-9081875 |
| 2,3-Dichloro-6-fluorobenzylbromide | 886497-51-4 | 2A-9081879 |
| 2-Fluoro-5-(trifluoromethoxy)benzonitrile | 886498-08-4 | 2A-9081881 |
| 3-Fluoro-4-(trifluoromethoxy)benzoicacid | 886498-89-1 | 2A-9081882 |
| 3-Fluoro-4-(trifluoromethoxy)benzylamine | 886499-13-4 | 2A-9081884 |
| 2-Chloro-6-fluoro-3-methylbenzonitrile | 886500-98-7 | 2A-9081887 |
| 4-Bromo-5-fluoro-2-methoxyphenol | 886510-25-4 | 2A-9081888 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA