CAS Number213598-09-5
Synonyms3-(Trifluoromethyl)-p-anisic acid; 4-Methoxy-3-(trifluoromethyl)benzoic acid; 4-methoxy-3-trifluoromethyl-benzoic acid; JRD-0913; MFCD01091014
Molecular FormulaC9H7F3O3
Molecular Weight220.145
Density1.4±0.1 g/cm3
Boiling Point290.1±40.0 °C at 760 mmHg
Melting Point169-171ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 213598-09-5 |
| Catalog No. | 2A-9081864 |
| Chinese Name | 3－三氟甲基－4－甲氧基苯甲酸 |
| Synonyms | 3-(Trifluoromethyl)-p-anisic acid; 4-Methoxy-3-(trifluoromethyl)benzoic acid; 4-methoxy-3-trifluoromethyl-benzoic acid; JRD-0913; MFCD01091014 |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.145 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 290.1±40.0 °C at 760 mmHg |
| Melting Point | 169-171ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2918990090 |
| SMILES | COc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F3O3/c1-15-7-3-2-5(8(13)14)4-6(7)9(10,11)12/h2-4H,1H3,(H,13,14) |
| InChI Key | VNWUPESTVBTYJM-UHFFFAOYSA-N |
| MSDS | msds/81864_1_213598_09_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4,5-Dichloro-2-[4-(trifluoromethyl)phenyl]pyridazin-3(2H)-one | 62436-07-1 | 2A-9081848 |
| 2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoicacid | 680215-64-9 | 2A-9081850 |
| 5-(4-Bromophenyl)-2-(trifluoromethyl)-3-furoicacid | 229957-02-2 | 2A-9081853 |
| S-(Trifluoromethyl)dibenzothiophenium-3-sulfonateethanolate | 160656-62-2 | 2A-9081855 |
| Methyl4-([3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy)benzenecarboxylate | 7382-40-3 | 2A-9081861 |
| 4-Hydroxy-2-(trifluoromethyl)benzoicacid | 320-32-1 | 2A-9081866 |
| 2-(3-Chloro-5-(trifluoromethyl)phenyl)acetonitrile | 886496-95-3 | 2A-9081877 |
| 3-Chloro-5-(trifluoromethyl)anisole | 886497-07-0 | 2A-9081878 |
| 3-Fluoro-5-(trifluoromethyl)benzenesulphonylchloride | 886499-99-6 | 2A-9081886 |
| 4-(2,2,2-Trifluoroethoxy)phenylboronicacid | 886536-37-4 | 2A-9081889 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS