
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 247170-19-0 |
| Catalog No. | 2A-9081847 |
| Chinese Name | 2′-氯4′-(三氟甲基)乙酰苯胺 |
| Synonyms | HMS563K09; 2'-Chloro-4'-(trifluoromethyl)acetanilide; MFCD01313231 |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.60600 |
| Density | 1.414g/cm3 |
| Boiling Point | 306.5ºC at 760mmHg |
| Melting Point | 131 °C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2924299090 |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI Key | QRMZQPODCUCPQD-UHFFFAOYSA-N |
| MSDS | msds/81847_1_247170_19_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1,8-Diaza-spiro[4.5]decane-1-carboxylicacidtert-butylester | 885279-92-5 | 2A-9081799 |
| 4'-Nitro-3'-(Trifluoromethyl)Acetanilide | 393-12-4 | 2A-9081839 |
| N-2-Fluorophenyl-3-(trifluoromethyl)benzamide | 199461-55-7 | 2A-9081840 |
| 3-[2-Nitro-4-(trifluoromethyl)anilino]propanoicacid | 37040-43-0 | 2A-9081845 |
| 6-Methyl-5-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)nicotinicacid | 651004-85-2 | 2A-9081846 |
| 4,5-Dichloro-2-[4-(trifluoromethyl)phenyl]pyridazin-3(2H)-one | 62436-07-1 | 2A-9081848 |
| 2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoicacid | 680215-64-9 | 2A-9081850 |
| 5-(4-Bromophenyl)-2-(trifluoromethyl)-3-furoicacid | 229957-02-2 | 2A-9081853 |
| S-(Trifluoromethyl)dibenzothiophenium-3-sulfonateethanolate | 160656-62-2 | 2A-9081855 |
| Methyl4-([3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy)benzenecarboxylate | 7382-40-3 | 2A-9081861 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA