
CAS Number149105-11-3
SynonymsMFCD01091005; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethan-1-one; FXFFR BQ EV1; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]-1-ethanone; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethanone
Molecular FormulaC9H7F3O2
Molecular Weight204.146
Density1.3±0.1 g/cm3
Boiling Point254.7±35.0 °C at 760 mmHg
Melting Point176-177ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 149105-11-3 |
| Catalog No. | 2A-9081787 |
| Chinese Name | 4'-羟基-3'-(三氟甲基)苯乙酮 |
| Synonyms | MFCD01091005; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethan-1-one; FXFFR BQ EV1; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]-1-ethanone; 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethanone |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 254.7±35.0 °C at 760 mmHg |
| Melting Point | 176-177ºC |
| Appearance | solid |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| SMILES | CC(=O)c1ccc(O)c(C(F)(F)F)c1 |
| InChI Key | HKRUXZJKSFFSGF-UHFFFAOYSA-N |
| MSDS | msds/81787_1_149105_11_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,3-Dichloroisonicotinaldehyde | 884495-41-4 | 2A-9081734 |
| (1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentylamine | 884603-39-8 | 2A-9081738 |
| 3-Chloro-2-methoxyisonicotinaldehyde | 885167-89-5 | 2A-9081745 |
| 2-Bromo-6-nitro-4-(trifluoromethyl)aniline | 113170-71-1 | 2A-9081770 |
| 3'-(Trifluoromethylthio)acetophenone | 56773-33-2 | 2A-9081778 |
| 1,8-Diaza-spiro[4.5]decane-1-carboxylicacidtert-butylester | 885279-92-5 | 2A-9081799 |
| 4'-Nitro-3'-(Trifluoromethyl)Acetanilide | 393-12-4 | 2A-9081839 |
| N-2-Fluorophenyl-3-(trifluoromethyl)benzamide | 199461-55-7 | 2A-9081840 |
| 3-[2-Nitro-4-(trifluoromethyl)anilino]propanoicacid | 37040-43-0 | 2A-9081845 |
| 6-Methyl-5-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)nicotinicacid | 651004-85-2 | 2A-9081846 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA