
CAS Number72235-57-5
Synonyms4-Chloro-2-fluorobenzylamine; MFCD06212852; 1-(4-Chloro-2-fluorophenyl)methylamine; (4-Chloro-2-fluorophenyl)methylamine; 4-Chloro-2-fluorobenzenemethanamine; (4-Chloro-2-fluorophenyl)methanamine; 4-chloro-2-fluorobenzyl amine; 1-(4-Chloro-2-fluorophenyl)methanamine; Z1R DG BF
Molecular FormulaC7H7N1Cl1F1
Molecular Weight159.59
Density1.3±0.1 g/cm3
Boiling Point211.1±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72235-57-5 |
| Catalog No. | 2A-9081592 |
| Chinese Name | 4-氯-2-氟苄胺 |
| Synonyms | 4-Chloro-2-fluorobenzylamine; MFCD06212852; 1-(4-Chloro-2-fluorophenyl)methylamine; (4-Chloro-2-fluorophenyl)methylamine; 4-Chloro-2-fluorobenzenemethanamine; (4-Chloro-2-fluorophenyl)methanamine; 4-chloro-2-fluorobenzyl amine; 1-(4-Chloro-2-fluorophenyl)methanamine; Z1R DG BF |
| Molecular Formula | C7H7N1Cl1F1 |
| Molecular Weight | 159.59 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 211.1±25.0 °C at 760 mmHg |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | III |
| HTC | 2921499090 |
| MDL Number | MFCD06212852 |
| SMILES | NCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C7H7ClFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChI Key | ODMMHGMIZYLHNN-UHFFFAOYSA-N |
| MSDS | msds/81592_1_72235_57_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-2-nitrobenzylalcohol | 73033-58-6 | 2A-9081582 |
| 3,5-Dintro-4-HydroxybenzenesulfonicAcidPotassiumSalt | 74525-39-6 | 2A-9081584 |
| 3-Methyl-4-nitrobenzylalcohol | 80866-75-7 | 2A-9081587 |
| 3-Methyl-2-nitrobenzylalcohol | 80866-76-8 | 2A-9081589 |
| 2-Chloro-5-nitrobenzylalcohol | 80866-80-4 | 2A-9081591 |
| 4-Methyl-2-nitrobenzylalcohol | 81335-87-7 | 2A-9081593 |
| Tert-butylN-[2-(dimethylamino)-2-oxoEthyl]carbamate | 72287-76-4 | 2A-9081594 |
| P-Xylenolblue | 125-31-5 | 2A-9081595 |
| 2-Amino-N,N-dimethylacetamidehydrochloride | 72287-77-5 | 2A-9081596 |
| 3-Fluoro-5-iodobenzonitrile | 723294-75-5 | 2A-9081599 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA