
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 606-12-2 |
| Catalog No. | 2A-9081548 |
| Chinese Name | 2,4'-二羟基二苯甲酮 |
| Synonyms | MFCD02181674; 2,4'-dihydroxybenzophenone |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| Density | 1.302 g/cm3 |
| Boiling Point | 383.6ºC at 760 mmHg |
| Melting Point | 146.0-150.0°C |
| Appearance | solid |
| Storage Condition | 2. Storage This product should be sealed and store |
| HTC | 2914399090 |
| PubChem ID | 329777602 |
| MDL Number | MFCD02181674 |
| SMILES | Oc1ccc(cc1)C(=O)c2ccccc2O |
| InChI | 1S/C13H10O3/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8,14-15H |
| InChI Key | HUYKZYIAFUBPAQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/81548_1_606_12_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-2-hydroxybenzophenone | 55082-33-2 | 2A-9081543 |
| 1,2-Naphthalenediol | 574-00-5 | 2A-9081544 |
| 1-(2-Hydroxy-1-naphthalenyl)ethanone | 574-19-6 | 2A-9081545 |
| 1-Chloro-4-hydroxynaphthalene | 604-44-4 | 2A-9081546 |
| 2-Hydoxy-4-methoxy-5-sulfobenzophenone | 6045-45-6 | 2A-9081547 |
| 2',5-Dichloro-2-hydroxybenzophenone | 61785-35-1 | 2A-9081549 |
| 2'-Chloro-2-hydroxy-5-methylbenzophenone | 6280-52-0 | 2A-9081550 |
| 4-(2-BromoEthyl)benzonitrile | 72054-56-9 | 2A-9081551 |
| 2,7-Bis(2-sulfophenylazo)chromotropicacidtetrasodiumsalt | 68504-35-8 | 2A-9081552 |
| 5,5'-Methylenebis(2-hydroxy-4-methoxybenzophenone) | 68716-15-4 | 2A-9081553 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA