
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7159-96-8 |
| Catalog No. | 2A-9081468 |
| Chinese Name | N-(3-羟苯基)氨基甲酸乙酯 |
| Synonyms | ethyl N-(3-hydroxyphenyl)carbamate |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Density | 1.259 g/cm3 |
| Boiling Point | 266.4ºC at 760 mmHg |
| Melting Point | 96 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature, dry |
| HTC | 2924299090 |
| SMILES | CCOC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-2-13-9(12)10-7-4-3-5-8(11)6-7/h3-6,11H,2H2,1H3,(H,10,12) |
| InChI Key | KCLZXXMMEDEBMF-UHFFFAOYSA-N |
| MSDS | msds/81468_1_7159_96_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Ethyl-N-butylamine | 617-79-8 | 2A-9081462 |
| 2,2-Diphenyl-cyclopropanecarboxylicacid | 7150-12-1 | 2A-0200739 |
| 3,5-Dibromopicolinicacid | 61830-40-8 | 2A-9081464 |
| 4-Chloro-4'-hydroxybutyrophenone | 7150-55-2 | 2A-9081465 |
| 2-Amino-3-phenylbutanoicacidhydrochloride | 80997-87-1 | 2A-9081467 |
| 2-PhenylEthylnicotinate | 71653-43-5 | 2A-9081470 |
| 2-Chloro-1,4-dinitrobenzene | 619-16-9 | 2A-9081471 |
| Ac-D-phe-ome | 21156-62-7 | 2A-9081474 |
| L-Alloisoleucinemethylesterhydrochloride | 71776-74-4 | 2A-9081478 |
| N-(2-AminoEthyl)phthalimide | 71824-24-3 | 2A-9081480 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA