
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52780-14-0 |
| Catalog No. | 2A-9081328 |
| Chinese Name | 3-溴-Alpha-甲基苯甲醇 |
| Synonyms | MFCD00021863; 1-(3-Bromophenyl)ethanol; EINECS 258-177-7; 3-Bromo-α-methylbenzyl alcohol; 3-Bromo-alpha-methylbenzenemethanol |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.061 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 264.2±15.0 °C at 760 mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906299090 |
| SMILES | CC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C8H9BrO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| InChI Key | ULMJQMDYAOJNCC-UHFFFAOYSA-N |
| MSDS | msds/81328_1_52780_14_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-hydroxybenzoicacid | 3964-58-7 | 2A-9081322 |
| 2-Hydroxy-6-isopropyl-3-methylbenzoicacid | 4389-53-1 | 2A-9081324 |
| Coniferylalcohol | 458-35-5 | 2A-9081325 |
| 2,5-Dimethylresorcinol | 488-87-9 | 2A-9081326 |
| Benzilicacidethylester | 52182-15-7 | 2A-9081327 |
| 5-Bromothiophen-2-ylmethylamine | 612499-04-4 | 2A-9081329 |
| 2-Hydroxy-3-isopropyl-6-methylbenzoicacid | 548-51-6 | 2A-9081330 |
| 2-(1H-Imidazol-1-yl)aniline | 26286-54-4 | 2A-9081331 |
| 5-Iodo-2-methoxyaniline | 77770-09-3 | 2A-9081332 |
| 2-Iodonaphthalene | 612-55-5 | 2A-9081333 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA