
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 612-17-9 |
| Catalog No. | 2A-9081293 |
| Chinese Name | 1,4-二氢萘 |
| Synonyms | EINECS 210-297-0; MFCD00058963; 1,4-DIHYDRONAPHTHALENE |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 |
| Density | 1,01 g/cm3 |
| Boiling Point | 212°C |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2902909090 |
| MDL Number | MFCD00058963 |
| SMILES | C1=CCc2ccccc2C1 |
| InChI | InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-6H,7-8H2 |
| InChI Key | FUPIVZHYVSCYLX-UHFFFAOYSA-N |
| MSDS | msds/81293_1_612_17_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 80.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Pyrrolidin-1-ylaniline | 115833-93-7 | 2A-9081275 |
| 3-(2-Thienyl)aniline | 92057-12-0 | 2A-9081277 |
| 5-(Benzyloxy)-2-bromo-4-methylaniline | 499770-88-6 | 2A-9081278 |
| 3-(Benzyloxy)-4-methylphenylamine | 219492-12-3 | 2A-9081279 |
| 2-Methylstyrene | 611-15-4 | 2A-9081280 |
| 5-Amino-2-(phenoxy)benzotrifluoride | 267416-81-9 | 2A-9081294 |
| 2-Amino-5-(methylthio)benzotrifluoride | 59920-85-3 | 2A-9081295 |
| 2-(Hydroxymethyl)-benzoicacid | 612-20-4 | 2A-9081296 |
| 2-(2-Morpholin-4-ylethoxy)aniline | 64039-56-1 | 2A-9081297 |
| 4-(2-Morpholin-4-yl-ethoxy)phenylamine | 52481-41-1 | 2A-9081298 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA