
CAS Number6118-51-0
SynonymsEINECS 226-570-2; EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE; MFCD00151506; (3aR,4S,7R,7aS)-3a,4,7,7a-Tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione; (1R,2S,6R,7S)-4,10-Dioxatricyclo[5.2.1.0]dec-8-ene-3,5-dione; anhydride of rel-(1R,2S,3R,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid
Molecular FormulaC8H6O4
Molecular Weight166.13
Density1.5±0.1 g/cm3
Boiling Point372.0±42.0 °C at 760 mmHg
Melting Point118 °C (dec.) (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6118-51-0 |
| Catalog No. | 2A-9081284 |
| Chinese Name | exo-7-氧杂二环[2.2.1]庚基-5-烯-2,3-二羧酸酐 |
| Synonyms | EINECS 226-570-2; EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE; MFCD00151506; (3aR,4S,7R,7aS)-3a,4,7,7a-Tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione; (1R,2S,6R,7S)-4,10-Dioxatricyclo[5.2.1.0]dec-8-ene-3,5-dione; anhydride of rel-(1R,2S,3R,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 372.0±42.0 °C at 760 mmHg |
| Melting Point | 118 °C (dec.) (lit.) |
| Appearance | solid |
| Water Solubility | Hydrolyzes in water. |
| Storage Condition | Store under inert gas; avoid moisture (decompositi |
| HTC | 2932999099 |
| PubChem ID | 24859882 |
| MDL Number | MFCD00151506 |
| SMILES | O=C1OC(=O)[C@H]2C3OC(C=C3)[C@@H]12 |
| InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| InChI Key | QQYNRBAAQFZCLF-FBXFSONDSA-N |
| Beilstein/REAXYS | 10355 |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/81284_1_6118_51_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Bromomethyl)thiazol-2-aminehydrobromide | 610278-79-0 | 2A-9081268 |
| 4-Amino-3',5'-bis(trifluoromethyl)biphenyl | 444143-45-7 | 2A-9081276 |
| 4-[4-(Trifluoromethyl)phenoxy]-2-methylaniline | 102766-74-5 | 2A-9081281 |
| 2,3,6-Trichloro-4-(trifluoromethyl)aniline | 86399-04-4 | 2A-9081282 |
| 5-Methyl-2-(trifluoromethyl)aniline | 106877-29-6 | 2A-9081283 |
| 4-Methylthio-3-(trifluoromethyl)aniline | 63094-56-4 | 2A-9081288 |
| 3,5-Difluoro-2-(trifluoromethyl)aniline | 123973-33-1 | 2A-9081289 |
| 2,6-Dichloro-4-(trifluoromethylthio)aniline | 99479-65-9 | 2A-9081290 |
| 4-[2,6-Dichloro-4-(trifluoromethyl)phenoxy]aniline | 61946-83-6 | 2A-9081291 |
| 2-Chloro-4-nitro-6-(trifluoromethyl)aniline | 400-67-9 | 2A-9081292 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA