
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6057-60-9 |
| Catalog No. | 2A-9081204 |
| Chinese Name | 4-(4-联苯)丁酸 |
| Synonyms | 4-biphenyl-4-yl-butyric acid; 4-BIPHENYLBUTYRIC ACID |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Density | 1.117g/cm3 |
| Boiling Point | 414.365ºC at 760 mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2916399090 |
| SMILES | O=C(O)CCCc1ccc(-c2ccccc2)cc1 |
| InChI Key | XSFAQQLHYUBFKV-UHFFFAOYSA-N |
| MSDS | msds/81204_1_6057_60_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Morpholin-4-ylbutan-2-one | 6050-58-4 | 2A-9081195 |
| 1,4-Diamidoximobenzene | 6051-62-3 | 2A-9081197 |
| 1-Propyl-1H-benzoimidazol-2-ylamine | 57667-50-2 | 2A-9081199 |
| Methyl2-(2-pyrimidyl)acetate | 60561-50-4 | 2A-9081200 |
| 1-(3-Dimethylamino-propyl)-1H-benzoimidazol-2-ylamine | 38652-80-1 | 2A-9081203 |
| 4-Iodo-2-methylphenol | 60577-30-2 | 2A-9081206 |
| Methyl3-amino-4-(isopropylamino)benzoate | 511240-22-5 | 2A-9081207 |
| 4-Iodo-N-methylaniline | 60577-34-6 | 2A-9081208 |
| 3',5'-DiMethyl-4'-methoxyacetophenone | 60609-65-6 | 2A-9081209 |
| O-Phospho-L-threonine | 1114-81-4 | 2A-9081210 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA