
CAS Number604-80-8
SynonymsIsorhamnetin 3-O-rutinoside; Narcissoside; Narcissin; Isorhamnetin 3-rhamnoglucoside; Narcisin; Isorhamnetin-3-O-Beta-D-rutinoside; Isorhamnetin 3-rutinoside
Molecular FormulaC28H32O16
Molecular Weight624.54
Purity≥95.0 (HPLC)%
Density1.7±0.1 g/cm3
Boiling Point953.1±65.0 °C at 760 mmHg
Melting Point182-184ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 604-80-8 |
| Catalog No. | 2A-9081193 |
| Chinese Name | 水仙苷 |
| Synonyms | Isorhamnetin 3-O-rutinoside; Narcissoside; Narcissin; Isorhamnetin 3-rhamnoglucoside; Narcisin; Isorhamnetin-3-O-Beta-D-rutinoside; Isorhamnetin 3-rutinoside |
| Molecular Formula | C28H32O16 |
| Molecular Weight | 624.54 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 953.1±65.0 °C at 760 mmHg |
| Melting Point | 182-184ºC |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Narcissin (Narcissoside), a coptis glycoside isolated from Morinda citrifolia, scavenges ONOO- and SIN-1-derived ONOO- with IC50 of 3.5 and 9.6 μM, respectively. Has antioxidant activity. |
| HTC | 29389090 |
| SMILES | O[C@@H]([C@H](CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](C)O1)O2)[C@@H](O)[C@H](O)[C@H]2OC3=C(C4=CC=C(O)C(OC)=C4)OC5=CC(O)=CC(O)=C5C3=O |
| InChI | 1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16+,18-,19+,21+,22-,23+,24+,27+,28-/m1/s1 |
| InChI Key | UIDGLYUNOUKLBM-OWIBGMBDSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/81193_1_604_80_8.pdf |
| Transport Info | Product Name: Narcissus |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| Beta-Alaninet-butylester | 58620-93-2 | 2A-9080797 |
| 5-Dimethylaminonaphthalene-1-sulfonyl-L-valine | 1098-50-6 | 2A-9080996 |
| 5-Dimethylaminonaphthalene-1-sulfonyl-L-isoleucine | 1100-21-6 | 2A-9080998 |
| 5-Dimethylaminonaphthalene-1-sulfonyl-L-leucine | 1100-22-7 | 2A-9081000 |
| N-Epsilon-amino-L-arginineflavianate | 137361-06-9 | 2A-9081011 |
| 6-Methyl-DL-Tryptophan | 2280-85-5 | 2A-9081285 |
| 4-Chlorobenzoyl-L-Tryptophancalciumsalt | 56116-62-2 | 2A-9081287 |
| Glucosamine Sulfate Potassium Chloride | 2A-166370 | 2A-9081316 |
| L-Tyrosinehydrazide | 7662-51-3 | 2A-9081339 |
| 3-Amino-L-tyrosinedihydrochloride | 23279-22-3 | 2A-9081341 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA