
CAS Number34124-14-6
Synonyms2,2'-BITHIOPHENE; α,α'-Bi-o-toluidine; 2,2'-ethane-1,2-diyldianiline; 2,2'-Diamino-1,2-diphenylethane; 2,2'-diaminodibenzyl; 2,2'-Ethylenedianiline; 2,2'-Diaminobibenzyl; bibenzyl-2,2'-diyldiamine; EINECS 251-837-5; Bibenzyl-2,2'-diyldiamin
Molecular FormulaC14H16N2
Molecular Weight212.297
Purity97%
Density1.132g/cm3
Boiling Point382.4ºC at 760mmHg
Melting Point72-77ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34124-14-6 |
| Catalog No. | 2A-9081118 |
| Chinese Name | 2,2-亚乙基二苯胺 |
| Synonyms | 2,2'-BITHIOPHENE; α,α'-Bi-o-toluidine; 2,2'-ethane-1,2-diyldianiline; 2,2'-Diamino-1,2-diphenylethane; 2,2'-diaminodibenzyl; 2,2'-Ethylenedianiline; 2,2'-Diaminobibenzyl; bibenzyl-2,2'-diyldiamine; EINECS 251-837-5; Bibenzyl-2,2'-diyldiamin |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.297 |
| Purity | 97 |
| Density | 1.132g/cm3 |
| Boiling Point | 382.4ºC at 760mmHg |
| Melting Point | 72-77ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2921590090 |
| MDL Number | MFCD00127990 |
| SMILES | Nc1ccccc1CCc1ccccc1N |
| InChI | InChI=1S/C14H16N2/c15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8H,9-10,15-16H2 |
| InChI Key | ZYHQGITXIJDDKC-UHFFFAOYSA-N |
| MSDS | msds/81118_1_34124_14_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Dimethoxy-chlorobenzene | 7051-15-2 | 2A-9081103 |
| Methyl4,4,4-triflourocrotonate | 70577-95-6 | 2A-9081105 |
| 4,6-Dichloronicotinamide | 70593-57-6 | 2A-9081107 |
| O-T-Butyl-L-threonine | 4378-13-6 | 2A-9081115 |
| O-Methyl-L-threonine | 4144-02-9 | 2A-9081116 |
| 2-Methyl-5-isopropylaniline | 2051-53-8 | 2A-9081119 |
| N,N-Diethyl3-aminobenzenesulfonamide | 10372-41-5 | 2A-9081120 |
| 4-Fluoro-2-methyl-benzenesulfonamide | 489-17-8 | 2A-9081121 |
| 3-Chloro-5-fluoro-2-methylbenzenesulfonamide | 306937-31-5 | 2A-9081122 |
| N'-Hydroxy-3-methylbenzenecarboximidamide | 40067-82-1 | 2A-9081124 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA