
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 703-98-0 |
| Catalog No. | 2A-9081094 |
| Chinese Name | 1-(2-羟基-3-甲氧苯基)乙酮 |
| Synonyms | Exact Mass 166.06300; PSA 46.53000; LogP 1.60340; Index of Refraction 1.537; InChIKey VZEOJJIAYZCDPI-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17400 |
| Density | 1.158g/cm3 |
| Boiling Point | 247.2ºC at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2914509090 |
| SMILES | COc1cccc(C(C)=O)c1O |
| InChI | InChI=1S/C9H10O3/c1-6(10)7-4-3-5-8(12-2)9(7)11/h3-5,11H,1-2H3 |
| InChI Key | VZEOJJIAYZCDPI-UHFFFAOYSA-N |
| MSDS | msds/81094_1_703_98_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-Dimehtyl-N-pyridin-3-yl-propionamide | 70298-88-3 | 2A-9081084 |
| 4-Bromo-N-methyl-benzenesulfonamide | 703-12-8 | 2A-9081085 |
| 2'-Hydroxy-6'-Methoxyacetophenone | 703-23-1 | 2A-9081086 |
| 4,6-Dimethyl-5-pyrimidinol | 70345-38-9 | 2A-9081088 |
| 4-Bromo-2-butenoicacidmethylester | 6000-00-6 | 2A-9081091 |
| 3-Amino-3,4-dihydro-1,5-naphthyridin-2(1H)-one | 600157-67-3 | 2A-9081095 |
| (5-Chloro-2-methoxyphenyl)acetonitrile | 7048-38-6 | 2A-9081099 |
| 4,5-Difluoro-2-Methylphenol | 704884-76-4 | 2A-9081100 |
| 1-(6-(Dimethylamino)naphthalen-2-yl)propan-1-one | 70504-01-7 | 2A-9081101 |
| 3,4-(Methylenedioxy)phenEthylalcohol | 6006-82-2 | 2A-9081102 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA