
CAS Number701-56-4
Synonymsp-(dimethylamino)anisole; N,N-Dimethyl-p-methoxyaniline; 4-Methoxy-N,N-dimethylbenzenamine; 4-CH3O-N,N-dimethylaniline; N,N-Dimethyl-4-methoxyaniline; N,N-Dimethyl-p-anisidine; N,N-Dimethyl-para-anisidine; p-Methoxy-N,N-dimethylaniline; N,N'-dimethyl-p-methoxyaniline; 4-Methoxy-N,N-dimethylaniline; Benzenamine,4-methoxy-N,N-dimethyl; (4-Methoxy-phenyl)-dimethyl-amine
Molecular FormulaC9H13NO
Molecular Weight151.206
Density1.0±0.1 g/cm3
Boiling Point239.2±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 701-56-4 |
| Catalog No. | 2A-9081065 |
| Chinese Name | 4-甲氧基-N,N-二甲基苯胺 |
| Synonyms | p-(dimethylamino)anisole; N,N-Dimethyl-p-methoxyaniline; 4-Methoxy-N,N-dimethylbenzenamine; 4-CH3O-N,N-dimethylaniline; N,N-Dimethyl-4-methoxyaniline; N,N-Dimethyl-p-anisidine; N,N-Dimethyl-para-anisidine; p-Methoxy-N,N-dimethylaniline; N,N'-dimethyl-p-methoxyaniline; 4-Methoxy-N,N-dimethylaniline; Benzenamine,4-methoxy-N,N-dimethyl; (4-Methoxy-phenyl)-dimethyl-amine |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.206 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 239.2±23.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| SMILES | COc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C9H13NO/c1-10(2)8-4-6-9(11-3)7-5-8/h4-7H,1-3H3 |
| InChI Key | ZTKDMNHEQMILPE-UHFFFAOYSA-N |
| MSDS | msds/81065_1_701_56_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Propoxy-4'-biphenylcarboxylicacid | 59748-13-9 | 2A-9081058 |
| Methyl4-formylamino-3-methoxybenzoate | 700834-18-0 | 2A-9081059 |
| 3-Amino-4-Methyl-2-pentenoicacidethylester | 70106-45-5 | 2A-9081060 |
| 7-Chloro-2-methylquinazolin-4-ol | 7012-88-6 | 2A-9081062 |
| 3-(3'-Pyridyl)phenylaceticacid | 597584-62-8 | 2A-9081063 |
| 2-Chloro-2-propen-1-ol | 5976-47-6 | 2A-9081066 |
| 1-Phenyl-2-butanol | 701-70-2 | 2A-9081069 |
| Methyl3-bromoisonicotinate | 59786-31-1 | 2A-9081071 |
| Methyltrioxorhenium(VII) | 70197-13-6 | 2A-0202141 |
| DiMethyl4-hydroxyisophthalate | 5985-24-0 | 2A-9081075 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA