
CAS Number19013-10-6
Synonyms4-Hydroxy-3-nitro-benzoesaeure-aethylester; ethyl 3-nitro-4-hydroxybenzoate; 4-hydroxy-3-nitro benzoic acid ethyl ester; benzoic acid,4-hydroxy-3-nitro-,ethyl ester; EINECS 242-751-9; 4-ethoxycarbonyl-2-nitrophenol; MFCD00016999; BEN436
Molecular FormulaC9H9NO5
Molecular Weight211.17100
Density1.37g/cm3
Boiling Point323.5ºC at 760mmHg
Melting Point69-71°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19013-10-6 |
| Catalog No. | 2A-9080995 |
| Chinese Name | 4-羟基-3-硝基苯甲酸乙酯 |
| Synonyms | 4-Hydroxy-3-nitro-benzoesaeure-aethylester; ethyl 3-nitro-4-hydroxybenzoate; 4-hydroxy-3-nitro benzoic acid ethyl ester; benzoic acid,4-hydroxy-3-nitro-,ethyl ester; EINECS 242-751-9; 4-ethoxycarbonyl-2-nitrophenol; MFCD00016999; BEN436 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Density | 1.37g/cm3 |
| Boiling Point | 323.5ºC at 760mmHg |
| Melting Point | 69-71°C |
| Appearance | solid |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2918290000 |
| MDL Number | MFCD28976547 |
| SMILES | [N+](=O)([O-])c1c(c(cc(c1)CC)C(=O)OC)O |
| InChI | 1S/C10H11NO5/c1-3-6-4-7(10(13)16-2)9(12)8(5-6)11(14)15/h4-5,12H,3H2,1-2H3 |
| InChI Key | GYWAKHKCALPVBI-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/80995_1_19013_10_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-Diphenylpropylaminehydrochloride | 40691-66-5 | 2A-9080989 |
| 1-(5-Bromothiophen-3-yl)ethanone | 59227-67-7 | 2A-9080990 |
| N,N'-Di-N-propylthiourea | 26536-60-7 | 2A-9080991 |
| 2,3,4-Trihydroxydiphenylmethane | 17345-66-3 | 2A-9080992 |
| Diethyl2-([(2-chloro-3-pyridyl)carbonyl]amino)malonate | 219793-85-8 | 2A-9080994 |
| 7-Hydroxy-4-propyl-2H-chromen-2-one | 19225-02-6 | 2A-9080997 |
| 2,6-Dibromo-4-isopropylaniline | 10546-65-3 | 2A-9081001 |
| 5-tert-Butylpyrogallol | 20481-17-8 | 2A-9081002 |
| 4-Aminobenzoicacidisopropylester | 18144-43-9 | 2A-9081003 |
| 4-AminobenzoicacidN-propylester | 94-12-2 | 2A-9081005 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA