![1-[(Dimethylamino)methyl]-2-naphthol structure, CAS 5419-02-3](/structures/100000/80771_1_5419_02_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5419-02-3 |
| Catalog No. | 2A-9080771 |
| Chinese Name | 1-(二甲基胺甲基)萘酚 |
| Synonyms | MFCD00086150; 1-DIMETHYLAMINOMETHYL-2-NAPHTHOL; 1-[(DIMETHYLAMINO)METHYL]-2-NAPHTHOL; N,N-dimethyl-1-aminomethyl-2-naphthol; F3097-2765 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.271 |
| Density | 1.127g/cm3 |
| Boiling Point | 325.8ºC at 760mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2922299090 |
| MDL Number | MFCD00086150 |
| SMILES | CN(C)Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C13H15NO/c1-14(2)9-12-11-6-4-3-5-10(11)7-8-13(12)15/h3-8,15H,9H2,1-2H3/p+1 |
| InChI Key | GOHHBFSPKLRUNF-UHFFFAOYSA-N |
| MSDS | msds/80771_1_5419_02_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclopropyl4-methoxydiphenylcarbinol | 62587-03-5 | 2A-9080763 |
| 5-Diethylamino-2-pentanol | 5412-69-1 | 2A-9080764 |
| Cycloprpopyldiphenylcarbinol | 5785-66-0 | 2A-9080765 |
| Salicylideneamino-2-thiophenol | 3449-05-6 | 2A-9080768 |
| (E)-1,4-BIS(-4-BROMOSTYRYL)BENZENE | 58358-55-7 | 2A-9080770 |
| 2-Bromo-4-benzenediol | 583-69-7 | 2A-9080772 |
| 1-Naphthol-3-sulfonicacidsodiumsalt | 13935-00-7 | 2A-9080773 |
| 6,6'-Dimethyl-1,1'-bi-2-naphthol | 172170-94-4 | 2A-9080775 |
| 1-N-Butyl-1-tosylmethylisocyanide | 58379-83-2 | 2A-9080777 |
| 1-Allyl-1-tosylmethylisocyanide | 58379-85-4 | 2A-9080778 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA