
CAS Number1795-48-8
Synonyms2-PROPYLISOCYANATE; Isocyanic Acid Isopropyl Ester; EINECS 217-276-5; ISOPROPYLISOCYANATE; 2-isocyanato-propane; i-propyl isocyanate; Isorpopyl Isocyanate; 1-methylethyl isocyanate; Isopropyl Isocyanate; Isopropylisocyanat; MFCD00002037; i-pic; 2-isocyanato-propan
Molecular FormulaC4H7NO
Molecular Weight85.104
Purity98%
Density0.9±0.1 g/cm3
Boiling Point76.6±9.0 °C at 760 mmHg
Melting Point<-75ºC
AppearanceA colorless liquid with a spicy odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1795-48-8 |
| Catalog No. | 2A-9008077 |
| Chinese Name | 异丙基异氰酸酯 |
| Synonyms | 2-PROPYLISOCYANATE; Isocyanic Acid Isopropyl Ester; EINECS 217-276-5; ISOPROPYLISOCYANATE; 2-isocyanato-propane; i-propyl isocyanate; Isorpopyl Isocyanate; 1-methylethyl isocyanate; Isopropyl Isocyanate; Isopropylisocyanat; MFCD00002037; i-pic; 2-isocyanato-propan |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.104 |
| Purity | 98 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 76.6±9.0 °C at 760 mmHg |
| Melting Point | <-75ºC |
| Appearance | A colorless liquid with a spicy odor |
| Water Solubility | Insoluble |
| Storage Condition | Refrigerate in a tightly sealed container and stor |
| Packaging | I |
| HTC | 2929109000 |
| SMILES | CC(C)N=C=O |
| InChI | InChI=1S/C4H7NO/c1-4(2)5-3-6/h4H,1-2H3 |
| InChI Key | GSLTVFIVJMCNBH-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/8077_2_1795_48_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Ethyl 4-{4-4-(hydroxydiphenylmethyl)-1-piperidinyl-1-oxobutyl}-2,6-dimethylbenzeneacetate hydrochloride | 2A-107740 | 2A-9007740 |
| Heptyl isothiocyanate | 4426-83-9 | 2A-9007946 |
| Hexadecyl isothiocyanate | 4426-87-3 | 2A-9007955 |
| Hexyl isothiocyanate | 4404-45-9 | 2A-9007980 |
| Isobutyl (S)-2-chloropropionate | 83261-15-8 | 2A-9008063 |
| L-tert-Butoxycarbonylthreonine amide | 2A-108151 | 2A-9008151 |
| Magnesium (S)-3-amino-3-carboxypropanoate tetrahydrate | 2A-108169 | 2A-9008169 |
| Methyl (2R,3S)-2,3-epoxy-3-(4-methoxyphenyl)propronate | 105560-93-8 | 2A-9008200 |
| Methyl (S)-(-)-2-chloropropionate | 73246-45-4 | 2A-9008202 |
| Methyl isothiocyanate | 556-61-6 | 2A-9008290 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA