
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18430-74-5 |
| Catalog No. | 2A-9080749 |
| Chinese Name | 1-(3,5-二氯-2-羟基苯基)丙-1-酮 |
| Synonyms | 3,5-dichloro-2-hydroxypropiophenone; 3,5-Dichlor-2-hydroxypropiophenon; 3,5-Dichloro-2-hydroxypropiophenon |
| Molecular Formula | C13H8Cl2FNO |
| Molecular Weight | 284.119 |
| Density | 1.37 g/cm3 |
| Boiling Point | 309.5ºCat 760 mmHg |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2914700090 |
| MDL Number | MFCD00091766 |
| SMILES | CCC(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H8Cl2O2/c1-2-8(12)6-3-5(10)4-7(11)9(6)13/h3-4,13H,2H2,1H3 |
| InChI Key | OYUBSDJHAZSFHZ-UHFFFAOYSA-N |
| MSDS | msds/80749_1_18430_74_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-ChloroEthylbenzoate | 5819-19-2 | 2A-9080739 |
| 2',4'-Dihydroxy-3'-methylpropiophenone | 63876-46-0 | 2A-9080741 |
| 2',5'-Dihydroxypropiophenone | 938-46-5 | 2A-9080743 |
| 2-Cyclohexyl-5-methylphenol | 1596-13-0 | 2A-9080745 |
| 3',4'-Dihydroxypropiophenone | 7451-98-1 | 2A-9080747 |
| 3-Chloro-5-Methylphenol | 58291-77-3 | 2A-9080750 |
| 3-Hydroxyhexadecanoicacid | 928-17-6 | 2A-9080751 |
| 3-Hydroxyphthalicacidanhydride | 37418-88-5 | 2A-9080752 |
| 4,6-Dinitroresocinol | 616-74-0 | 2A-9080753 |
| Ethyl-3-iodobenzoate | 58313-23-8 | 2A-9080754 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA