
CAS Number6589-48-6
SynonymsEINECS 229-523-4; 2-(cyclohexylamino)-1-phenylethan-1-ol; 2-Cyclohexylamino-1-phenyl-aethanol; MFCD00021321; Ethanol,2-cyclohexylamino-1-phenyl; 2-Cyclohexylamino-1-phenylethanol
Molecular FormulaC14H21NO
Molecular Weight219.33
Density1.04 g/cm3
Boiling Point84 °C
Melting Point58 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6589-48-6 |
| Catalog No. | 2A-9080746 |
| Chinese Name | 2-环己基氨基-1-苯基乙醇 |
| Synonyms | EINECS 229-523-4; 2-(cyclohexylamino)-1-phenylethan-1-ol; 2-Cyclohexylamino-1-phenyl-aethanol; MFCD00021321; Ethanol,2-cyclohexylamino-1-phenyl; 2-Cyclohexylamino-1-phenylethanol |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 |
| Density | 1.04 g/cm3 |
| Boiling Point | 84 °C |
| Melting Point | 58 °C |
| HTC | 2922199090 |
| MDL Number | MFCD00021321 |
| SMILES | OC(CNC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H21NO/c16-14(12-7-3-1-4-8-12)11-15-13-9-5-2-6-10-13/h1,3-4,7-8,13-16H,2,5-6,9-11H2 |
| InChI Key | ISYFTHDLBGNHQW-UHFFFAOYSA-N |
| MSDS | msds/80746_1_6589_48_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-Toluenesulfonicacid | 88-20-0 | 2A-9080364 |
| 2-Amino-1-phenylethanol | 7568-93-6 | 2A-9080466 |
| N-(3-Aminopropyl)diethanolamine | 4985-85-7 | 2A-9080480 |
| (4-Bromophenyl)(cyclopropyl)methanol | 70289-39-3 | 2A-9080712 |
| 1-Cyclopropyl-1-methylethanol | 930-39-2 | 2A-9080713 |
| (+/-)-1-(1-Naphthyl)ethanol | 1517-72-2 | 2A-9080774 |
| Lithiumtetramethanolatoborate | 6867-35-2 | 2A-9080874 |
| 2-Bromo-3-chlorotoluene | 69190-56-3 | 2A-9080902 |
| Bis(4-Hydroxy-1-naphthyl)phenylmethanol | 6948-88-5 | 2A-9080955 |
| 5-Methoxy-1,3-benzenedimethanol | 19254-84-3 | 2A-9080999 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA