
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67727-64-4 |
| Catalog No. | 2A-9080666 |
| Chinese Name | 3,4-二乙酰氧基苯甲醛 |
| Synonyms | (2-acetyloxy-4-formylphenyl) acetate |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.19400 |
| Density | 1.259g/cm3 |
| Boiling Point | 359.1ºC at 760 mmHg |
| Melting Point | 53ºC |
| Storage Condition | Room temperature, stored in inert gas |
| HTC | 2918300090 |
| SMILES | CC(=O)Oc1ccc(C=O)cc1OC(C)=O |
| InChI Key | WYHMNJKAVNPOOR-UHFFFAOYSA-N |
| MSDS | msds/80666_1_67727_64_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Methoxybenzaldehyde-3-sulfonicacidsodiumsalt | 5393-59-9 | 2A-9080661 |
| 3-Methoxy-4-propoxy-benzaldehyde | 57695-98-4 | 2A-9080662 |
| 3-(2-Hydroxyethoxy)benzaldehyde | 60345-97-3 | 2A-9080663 |
| 3,5-Dibromo-2-ethoxybenzaldehyde | 61657-67-8 | 2A-9080664 |
| 4-(Benzyloxy)-3-chlorobenzaldehyde | 66422-84-2 | 2A-9080665 |
| 2-Allyl-3-hydroxybenzaldehyde | 79950-42-8 | 2A-9080668 |
| 4-[(3-Chlorobenzyl)oxy]benzenecarbaldehyde | 59067-43-5 | 2A-9080670 |
| 3-Bromo-4-methylbenzaldehyde | 36276-24-1 | 2A-9080695 |
| 4-Phenylethynyl-benzaldehyde | 57341-98-7 | 2A-9080699 |
| 4-N-Propoxybenzaldehyde | 5736-85-6 | 2A-9080704 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA