
CAS Number54381-13-4
SynonymsN-(4-Methoxyphenyl)-2-nitrobenzenamine; 4-Methoxy-2'-nitrodiphenylamine; (4-methoxy-phenyl)-(2-nitro-phenyl)-amine; 2-nitro-4'-methoxydiphenylamine; 4-methoxy-N-(2-nitrophenyl)benzenamine; MFCD03410307; 4-methoxy-N-(2-nitrophenyl)aniline; N-(4'-methoxyphenyl)-2-nitrophenylamine
Molecular FormulaC13H12N2O3
Molecular Weight204.19
Density1.276 g/cm3
Boiling Point387.9ºC at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54381-13-4 |
| Catalog No. | 2A-9080612 |
| Chinese Name | 4-甲氧基-2'-硝基联苯胺 |
| Synonyms | N-(4-Methoxyphenyl)-2-nitrobenzenamine; 4-Methoxy-2'-nitrodiphenylamine; (4-methoxy-phenyl)-(2-nitro-phenyl)-amine; 2-nitro-4'-methoxydiphenylamine; 4-methoxy-N-(2-nitrophenyl)benzenamine; MFCD03410307; 4-methoxy-N-(2-nitrophenyl)aniline; N-(4'-methoxyphenyl)-2-nitrophenylamine |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 204.19 |
| Density | 1.276 g/cm3 |
| Boiling Point | 387.9ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2922199090 |
| PubChem ID | 329777436 |
| MDL Number | MFCD05228759 |
| SMILES | O=C(O)C(C)(C)NC1=CC=C(OC)C=C1 |
| InChI | 1S/C11H15NO3/c1-11(2,10(13)14)12-8-4-6-9(15-3)7-5-8/h4-7,12H,1-3H3,(H,13,14) |
| InChI Key | WCPRVWFUKWZJIK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352209 |
| MSDS | msds/80612_1_54381_13_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-4'-methyldiphenylether | 41295-20-9 | 2A-9080605 |
| Cyclopentyl-(4-Methoxy-Benzyl)-Amine | 435345-22-5 | 2A-9080606 |
| N-Phenyl-thiobenzamide | 636-04-4 | 2A-9080607 |
| 4'-Dimethylamino-2-phenylacetophenone | 97606-39-8 | 2A-9080608 |
| D-(-)-3-Amino-3-phenylpropionicacid | 83649-47-3 | 2A-9080609 |
| 1-Amino-7-naphthol | 118-16-7 | 2A-9080613 |
| 1-AminocyclobutanecarboxylicacidHCl | 98071-16-0 | 2A-9080614 |
| 2,4,6-Trimethylbenzenesulfonamide | 4543-58-2 | 2A-9080615 |
| N1-Benzylethane-1,2-diamine | 822-77-5 | 2A-9080616 |
| 2-Methyl-3-nitro-N,N-dipropylphenylacetamide | 91374-22-0 | 2A-9080617 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA