
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18992-80-8 |
| Catalog No. | 2A-9080585 |
| Chinese Name | 3'-二甲氨基苯乙酮 |
| Synonyms | Exact Mass 163.10000; PSA 20.31000; LogP 1.95520; Index of Refraction 1.46; InChIKey KYEMJVGXLJXCSM-UHFFFAOYSA-N |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.21600 |
| Density | 1.026g/cm3 |
| Boiling Point | 279.5ºC at 760mmHg |
| Melting Point | 37ºC |
| Storage Condition | room temperature, dry |
| HTC | 2922399090 |
| SMILES | CC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C10H13NO/c1-8(12)9-5-4-6-10(7-9)11(2)3/h4-7H,1-3H3 |
| InChI Key | KYEMJVGXLJXCSM-UHFFFAOYSA-N |
| MSDS | msds/80585_2_18992_80_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-(Dimethylamino)benzylidene-4-nitroaniline | 896-05-9 | 2A-9080565 |
| N,N,3,5-Tetramethylaniline | 4913-13-7 | 2A-9080576 |
| Laurylsulfatetrissalt | 50996-85-5 | 2A-9080577 |
| 4-(Diethylamino)benzoicacid | 5429-28-7 | 2A-9080578 |
| N-Benezyl-2-nitroaniline | 5729-06-6 | 2A-9080584 |
| DL-Alanyl-DL-alanine | 2867-20-1 | 2A-9080587 |
| 2-Nitroso-5-dimethylaminophenolhydrochloride | 41317-10-6 | 2A-9080588 |
| N,N-Dimethyl-3,5-dinitroaniline | 46429-76-9 | 2A-9080589 |
| 4'-Diethylaminoacetophenone | 5520-66-1 | 2A-9080590 |
| 4-(Dimethylamino)benzoin | 6317-85-7 | 2A-9080591 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA