
CAS Number29753-26-2
SynonymsN-(4-Aminophenyl)maleimide; 1-(4-Aminophenyl)-1H-pyrrole-2,5-dione; N-(4-Aminophenyl)-maleimide; EINECS 249-824-4; MFCD00051191
Molecular FormulaC10H8N2O2
Molecular Weight188.18
Density1.4±0.1 g/cm3
Boiling Point401.0±28.0 °C at 760 mmHg
Melting Point173 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29753-26-2 |
| Catalog No. | 2A-9080470 |
| Chinese Name | N-(4-氨苯基)马来酰亚胺 |
| Synonyms | N-(4-Aminophenyl)maleimide; 1-(4-Aminophenyl)-1H-pyrrole-2,5-dione; N-(4-Aminophenyl)-maleimide; EINECS 249-824-4; MFCD00051191 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 401.0±28.0 °C at 760 mmHg |
| Melting Point | 173 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 29054910 |
| PubChem ID | 329777465 |
| MDL Number | MFCD00051191 |
| SMILES | Nc1ccc(cc1)N2C(=O)C=CC2=O |
| InChI | 1S/C10H8N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6H,11H2 |
| InChI Key | XOPCHXSYQHXLHJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/80470_1_29753_26_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 93.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified N-(4-Aminophenyl)maleimide Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Aminobiphenyl | 2243-47-2 | 2A-9080457 |
| N-(2-Aminoethyl)-N-ethyl-M-toluidine | 23730-69-0 | 2A-9080462 |
| 1-Aminoheptadecane | 4200-95-7 | 2A-9080464 |
| 2-Di-Tert-butylphosphino-2',4',6'-triisopropylbiphenyl | 564483-19-8 | 2A-9080467 |
| 1-Aminononadecane | 14130-05-3 | 2A-9080469 |
| 2-(4-Morpholino)aniline | 5585-33-1 | 2A-9080471 |
| H-Lys(Z)-OtBu.HCl | 5978-22-3 | 2A-9080476 |
| 4-Aminophenylsuccinicacid | 22511-21-3 | 2A-9080478 |
| (4-Aminophenylthio)aceticacid | 104-18-7 | 2A-9080479 |
| Aminopropylon | 3690-04-8 | 2A-9080481 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA