
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55864-87-4 |
| Catalog No. | 2A-9080362 |
| Chinese Name | 4-硝基吡唑-5-羧酸乙酯 |
| Synonyms | ethyl 4-nitro-1H-pyrazole-5-carboxylate |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.13700 |
| Density | 1.455g/cm3 |
| Boiling Point | 365.022ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 329822940 |
| MDL Number | MFCD21090743 |
| SMILES | [O-][N+](C1=C(C(OC)=O)N(CC)N=C1)=O |
| InChI | 1S/C7H9N3O4/c1-3-9-6(7(11)14-2)5(4-8-9)10(12)13/h4H,3H2,1-2H3 |
| InChI Key | BGIFTQTZYMZQPN-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Aminomethylquinolinehydrochloride | 878778-84-8 | 2A-9080344 |
| 4-(1-Methylethenyl)-2-propyl-1-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-1H-Imidazole-5-carboxylicacid(5-Methyl-2-oxo-1,3-dioxol-4-yl)methylester | 879562-26-2 | 2A-9080351 |
| 2-Methyl-5-nitroimidazole | 88054-22-2 | 2A-9080358 |
| 2,5-Dichloropyridine-3-Methanol | 558465-93-3 | 2A-9080359 |
| 2,4,6-Trianilino(p-carbo-2-ethylhexyloxy)-1,3,5-triazine | 88122-99-0 | 2A-9080361 |
| 2-Chloro-5-fluoro-4-Methylpyridine | 881891-83-4 | 2A-9080363 |
| 6-Bromo-4-methoxy-2-(trifluoromethyl)quinoline | 882292-61-7 | 2A-9080365 |
| 2-Chloro-5-fluoro-3-hydroxypyridine | 884494-35-3 | 2A-9080376 |
| Ethyl4-amino-1H-pyrazole-5-carboxylate | 55904-61-5 | 2A-9080380 |
| 2-Fluoro-4-iodo-6-methylpyridine | 884494-45-5 | 2A-9080382 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA