
CAS Number5577-48-0
Synonymsmethyl butyl ketone oxime; Methyl N-butyl ketone oxime; 2-Hexanone oxime,syn+anti; Methyl n-butyl ketoxime; Methyl butyl ketoxime; Methyl-butyl-ketoxim; hexan-2-one oxime; Hexan-2-on-oxim
Molecular FormulaC30H30O2N6Cl1F1
Molecular Weight561.06
Density0.89 g/cm3
Boiling Point187.5ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5577-48-0 |
| Catalog No. | 2A-9080352 |
| Chinese Name | 2-己酮 肟, SYN+ANTI |
| Synonyms | methyl butyl ketone oxime; Methyl N-butyl ketone oxime; 2-Hexanone oxime,syn+anti; Methyl n-butyl ketoxime; Methyl butyl ketoxime; Methyl-butyl-ketoxim; hexan-2-one oxime; Hexan-2-on-oxim |
| Molecular Formula | C30H30O2N6Cl1F1 |
| Molecular Weight | 561.06 |
| Density | 0.89 g/cm3 |
| Boiling Point | 187.5ºC at 760 mmHg |
| HTC | 2928000090 |
| MDL Number | MFCD35067682 |
| SMILES | CCCCC(C)=NO |
| InChI | InChI=1S/C6H13NO/c1-3-4-5-6(2)7-8/h8H,3-5H2,1-2H3/b7-6- |
| InChI Key | WHXCGIRATPOBAY-UHFFFAOYSA-N |
| MSDS | msds/80352_1_5577_48_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-Methoxycarbonyl-2-Methylphenylboronicacid | 876189-18-3 | 2A-9080308 |
| 4-Methoxycarbonyl-3,5-diMethylphenylboronicacid | 876189-19-4 | 2A-9080309 |
| 5-(Methoxycarbonyl)furan-2-boronicacid | 876189-20-7 | 2A-9080310 |
| 3-Cyanopyridine-4-boronicacidpinacolester | 878194-92-4 | 2A-9080338 |
| 2,5-Difluoro-4-methoxybenzaldehyde | 879093-08-0 | 2A-9080348 |
| 5-Chloro-2-fluoronicotinaldehyde | 882679-90-5 | 2A-9080366 |
| 2-Methyl-6-(trifluoromethyl)aniline | 88301-98-8 | 2A-9080368 |
| 4,4,5,5-TetraMethyl-2-(2-Methyl-4-nitrophenyl)-1,3,2-dioxaborolane | 883715-40-0 | 2A-9080373 |
| 2-Chloro-5-fluoroisonicotinaldehyde | 884494-54-6 | 2A-9080387 |
| 3-Tert-Butylphenylboronicacid | 560132-24-3 | 2A-9080403 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA