
CAS Number87736-74-1
Synonyms4-bromobenzyl dimethyl-t-butylsilyl ether; 1-Bromo-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-benzene; 4-Bromobenzyl dimethyl-tert-butylsilyl Ether; 4-bromobenzyl O-(tert-butyldimethylsilyl) ether; 1-Bromo-4-[[(tert-butyldimethylsilyl)oxy]methyl]benzene; ((4-Bromobenzyl)oxy)(tert-butyl)dimethylsilane; [(4-bromophenyl)methoxy](tert-butyl)dimethylsilane; 4-(tert-butyldimethylsilyloxymethyl)bromobenzene; 4-(t-butyldimethylsiloxymethyl)bromobenzene
Molecular FormulaC13H21O1Br1Si1
Molecular Weight301.3
Density1.145
Boiling Point338.833ºC at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 87736-74-1 |
| Catalog No. | 2A-9080326 |
| Chinese Name | [(4-溴代苄基)氧](叔丁基)二甲基硅烷 |
| Synonyms | 4-bromobenzyl dimethyl-t-butylsilyl ether; 1-Bromo-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-benzene; 4-Bromobenzyl dimethyl-tert-butylsilyl Ether; 4-bromobenzyl O-(tert-butyldimethylsilyl) ether; 1-Bromo-4-[[(tert-butyldimethylsilyl)oxy]methyl]benzene; ((4-Bromobenzyl)oxy)(tert-butyl)dimethylsilane; [(4-bromophenyl)methoxy](tert-butyl)dimethylsilane; 4-(tert-butyldimethylsilyloxymethyl)bromobenzene; 4-(t-butyldimethylsiloxymethyl)bromobenzene |
| Molecular Formula | C13H21O1Br1Si1 |
| Molecular Weight | 301.3 |
| Density | 1.145 |
| Boiling Point | 338.833ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | room temperature, dry |
| HTC | 2931900090 |
| MDL Number | MFCD07368899 |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Br)cc1 |
| InChI Key | OURCJXVOBHLREF-UHFFFAOYSA-N |
| MSDS | msds/80326_1_87736_74_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: [(4-bromobenzyl)oxy](tert-butyl)dimethylsilane |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chlorophenylacetate | 876-27-7 | 2A-9080313 |
| 2-Methylaminoisonicotinicacid | 876717-53-2 | 2A-9080320 |
| 2-Acetoxycinnamicacid | 55620-18-3 | 2A-9080321 |
| 2-Bromonicotinamide | 87674-18-8 | 2A-9080322 |
| 2-Chloro-5-fluoroisonicotinicacidmethylester | 876919-10-7 | 2A-9080324 |
| 2-Bromo-1-(4-chlorophenyl)propan-1-one | 877-37-2 | 2A-9080328 |
| l-Tyrosinolhydrochloride | 87745-27-5 | 2A-9080331 |
| 1-(2-Chloro-6-hydroxyphenyl)ethanone | 55736-04-4 | 2A-9080332 |
| 3-Chloro-4-(methylthio)phenylacetic | 87776-75-8 | 2A-9080333 |
| 7-Fluoro-3,4-dihydro-4-[(5-isoquinolinyloxy)acetyl]-3,3-diMethyl-2(1H)-quinoxalinone | 878292-18-3 | 2A-9080339 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA