
CAS Number67853-03-6
SynonymsMethyl 3-hydroxymethylbenzoate; Benzoic acid,3-(hydroxymethyl)-,methyl ester; 3-hydroxymethylbenzoic acid methyl ester; methyl m-hydroxymethylbenzoate; m-methoxycarbonylbenzyl alcohol
Molecular FormulaC9H10O3
Molecular Weight166.18
Density1.177g/cm3
Boiling Point296.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67853-03-6 |
| Catalog No. | 2A-9080237 |
| Chinese Name | 3-羟甲基苯甲酸甲酯 |
| Synonyms | Methyl 3-hydroxymethylbenzoate; Benzoic acid,3-(hydroxymethyl)-,methyl ester; 3-hydroxymethylbenzoic acid methyl ester; methyl m-hydroxymethylbenzoate; m-methoxycarbonylbenzyl alcohol |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 |
| Density | 1.177g/cm3 |
| Boiling Point | 296.5ºC at 760mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918199090 |
| MDL Number | MFCD06202752 |
| SMILES | COC(=O)c1cccc(CO)c1 |
| InChI | InChI=1S/C9H10O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-5,10H,6H2,1H3 |
| InChI Key | FGOQWQMPNSYDBL-UHFFFAOYSA-N |
| MSDS | msds/80237_1_67853_03_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,6-Anhydro-2-azido-2-deoxy-β-D-glucopyranose | 67546-20-7 | 2A-9080230 |
| 2-(3'-Pyridyl)phenylaceticacid | 675602-63-8 | 2A-9080231 |
| 4-Amino-2-bromo-3-hydroxy-benzonitrile | 676124-40-6 | 2A-9080233 |
| FloralozoneFloralozone | 67634-14-4 | 2A-9080234 |
| Methyl2,5-dichloronicotinate | 67754-03-4 | 2A-9080235 |
| DodecaEthyleneglycol | 6790-09-6 | 2A-9080238 |
| Methyl3-amino-5-hydroxybenzoate | 67973-80-2 | 2A-9080240 |
| 4-[3,3-Bis(2-methoxyEthyl)ureido]benzenesulfonylchloride | 680185-48-2 | 2A-9080243 |
| Phenyl(pyrimidin-4-yl)methanone | 68027-80-5 | 2A-9080244 |
| 5-Hydroxyisophthalamide | 68052-43-7 | 2A-9080247 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA