
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 645-54-5 |
| Catalog No. | 2A-9080088 |
| Chinese Name | 2-苯基硫代乙酰胺 |
| Synonyms | 2-phenylethanethioamide; MFCD00022177 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.22900 |
| Density | 1.155g/cm3 |
| Boiling Point | 277.3ºC at 760 mmHg |
| Melting Point | 96-98ºC |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2930909090 |
| SMILES | NC(=S)Cc1ccccc1 |
| InChI | InChI=1S/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChI Key | CJXBHFANXQMZBF-UHFFFAOYSA-N |
| MSDS | msds/80088_1_645_54_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Phenylthioacetamide Modification number: 5.3 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-N,N-Dimethylbenzylamine | 6406-74-2 | 2A-9080073 |
| 5-Isopropylpyrimidin-2(1H)-one | 64171-58-0 | 2A-9080077 |
| 5-Chloro-6-hydroxy-1H-pyridazin-4-one | 64178-58-1 | 2A-9080078 |
| 1,2-Difluoro-3-iodo-benzene | 64248-57-3 | 2A-9080080 |
| 1-Chloro-3-(4-chlorophenyl)propane | 64473-34-3 | 2A-9080086 |
| Hydrocinnamonitrile | 645-59-0 | 2A-9080089 |
| 1-(2-Aminophenyl)-2-chloroethanone | 64605-23-8 | 2A-9080091 |
| 1,2-Benzenedisulfonyldichloride | 6461-76-3 | 2A-9080093 |
| 2-Bromo-4,5-difluorobenzonitrile | 64695-82-5 | 2A-9080094 |
| 4-Methyl-1H-pyrazol-3-amine | 64781-79-9 | 2A-9080095 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA