
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63791-85-5 |
| Catalog No. | 2A-9080064 |
| Chinese Name | 2-乙基-3-甲基丁酸乙酯 |
| Synonyms | Butanoic acid,2-ethyl-3-methyl,ethyl ester |
| Molecular Formula | CH3COC(OH)(13CH3)COOCH2CH3 |
| Molecular Weight | 161.16 |
| Purity | 97 (CP) |
| Density | 0.872g/cm3 |
| Boiling Point | 165.2ºC at 760 mmHg |
| Appearance | liquid |
| Storage Condition | 2-8°C |
| HTC | 2915900090 |
| PubChem ID | 329764487 |
| MDL Number | MFCD28137387 |
| SMILES | CC(C(O)([13CH3])C(OCC)=O)=O |
| InChI | 1S/C7H12O4/c1-4-11-6(9)7(3,10)5(2)8/h10H,4H2,1-3H3/i3+1 |
| InChI Key | WRZDWHWHFIFBOC-LBPDFUHNSA-N |
| UNSPSC | 12352108 |
| MSDS | msds/80064_1_63791_85_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Pseudotropin | 637-23-0 | 2A-9080057 |
| 4H-1,4-Benzodiazepine-4,8-dicarboxylicacid-1,2,3,5-tetrahydro-2-oxo-4-(1,1-DimethylEthyl)ester | 637338-11-5 | 2A-9080058 |
| Methyl2-(2-ethynylphenyl)acetate | 637348-19-7 | 2A-0202178 |
| Thiocarbonyl-carbamidsaeure-phenylester | 6374-24-9 | 2A-9080060 |
| 2-Acrylate-4-oxa-tricyclo[4.2.1.03.7]nonan-5-one | 637743-18-1 | 2A-9080063 |
| 2-Bromo-4-chloro-1-nitrobenzene | 63860-31-1 | 2A-9080068 |
| (4-AminoMethylpyridin-2-yl)carbamicacidtert-butylester | 639091-78-4 | 2A-9080070 |
| 5-Bromobenzo[d]oxazol-2-amine | 64037-07-6 | 2A-9080072 |
| 4-Amino-N,N-Dimethylbenzylamine | 6406-74-2 | 2A-9080073 |
| 5-Isopropylpyrimidin-2(1H)-one | 64171-58-0 | 2A-9080077 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA