
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6323-18-8 |
| Catalog No. | 2A-9080036 |
| Chinese Name | 1-(2-氯苯)-丙烷-1-酮 |
| Synonyms | 1-(2-Chlorophenyl)-1-propanone; 1-(2-chlorophenyl)propan-1-one |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.620 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 215.6±13.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 91032 |
| SMILES | CCC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C9H9ClO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| InChI Key | BTSCBJDORATYKJ-UHFFFAOYSA-N |
| MSDS | msds/80036_1_6323_18_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Aminohydantoin | 6301-02-6 | 2A-9080029 |
| Methyl4-mercaptobenzoate | 6302-65-4 | 2A-9080030 |
| 4-Hydroxy-N,N-Di(iso)propyltryptaminehydrochloride | 63065-90-7 | 2A-9080031 |
| 4-Hydroxy-di-isopropyl-tryptamine(4-HO-DiPT) | 63095-90-7 | 2A-9080032 |
| 4-Benzylaniline | 6317-57-3 | 2A-9080034 |
| Tetraphenylhydrazine | 632-52-0 | 2A-9080037 |
| 6-Benzyl-2-thiouracil | 6336-50-1 | 2A-9080040 |
| 2-Chloro-5-methylbenzoicacid | 6342-60-5 | 2A-9080042 |
| 1-(2-Bromo-5-methoxyphenyl)ethanone | 6342-63-8 | 2A-9080043 |
| 4-Chloroisatin | 6344-05-4 | 2A-9080045 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA