
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54916-27-7 |
| Catalog No. | 2A-9079998 |
| Chinese Name | 1-(4-(4-溴苯氧基)苯基)乙酮 |
| Synonyms | 1-[4-(4-Bromophenoxy)phenyl]ethanone; 1-[4-(4-Bromo-phenoxy)-phenyl]-etha; none |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.147 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 378.0±22.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| MDL Number | MFCD07776889 |
| SMILES | CC(=O)c1ccc(Oc2ccc(Br)cc2)cc1 |
| InChI Key | YLBRBIMNUGZGTD-UHFFFAOYSA-N |
| MSDS | msds/79998_1_54916_27_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Trimethylsiloxy)1,3-cyclohexadiene | 54781-19-0 | 2A-9079991 |
| Perinaphthenone | 548-39-0 | 2A-9079992 |
| 4-Ethylphenylhydrazine | 54840-34-5 | 2A-9079994 |
| (3-Benzyloxy-4-methoxyphenyl)aceticacid | 5487-33-2 | 2A-9079995 |
| 5-Bromo-Indol-3-propionicacid | 54904-23-3 | 2A-9079997 |
| 1,3-Diiodobenzene | 626-00-6 | 2A-9080002 |
| Methyl2-Methyl-4-nitrobenzoate | 62621-09-4 | 2A-9080004 |
| (Z)-Ethyl3-aminobut-2-enoate | 626-34-6 | 2A-9080005 |
| 4-Diethylaminomethylbenzoicacid | 62642-59-5 | 2A-9080006 |
| 4A,5,8,8a-Tetrahydro-[1,4]naphthoquinone | 6271-40-5 | 2A-9080008 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA