
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 624729-74-4 |
| Catalog No. | 2A-9079982 |
| Chinese Name | 8-氨基-3,4-二氢萘-1(2H)-酮 |
| Synonyms | 8-amino-3,4-dihydro-lH-naphthalen-2-one; 8-amino-3,4-dihydronaphthalen-2(1H)-one; 8-ammo-3,4-dihydro-1H-naphthalen-2-one |
| Molecular Formula | C14H19O2N2Br1 |
| Molecular Weight | 161.20000 |
| Density | 1.193g/cm3 |
| Boiling Point | 348.3ºC at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 41524100 |
| MDL Number | MFCD13195444 |
| SMILES | Brc1c2c(c(cc1)N)CN(CC2)C(=O)OC(C)(C)C |
| InChI | 1S/C14H19BrN2O2/c1-14(2,3)19-13(18)17-7-6-9-10(8-17)12(16)5-4-11(9)15/h4-5H,6-8,16H2,1-3H3 |
| InChI Key | DPCDGWCFUVLWBY-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/79982_1_624729_74_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Dibromoanisole | 62415-74-1 | 2A-9079976 |
| 2-Amino-4,6-diMethylNicotinonitrile | 5468-34-8 | 2A-9079977 |
| 3-Dimethylamino-2-isocyanoacrylicacidmethylester | 113212-14-9 | 2A-9079979 |
| 4-Dimethylamino-4'-methylazobenzene | 3010-57-9 | 2A-9079980 |
| Methyl4-iodo-3-methylbenzoate | 5471-81-8 | 2A-9079981 |
| 2-Benzylacrylicacid | 62479-28-1 | 2A-9079983 |
| 3-Amino-3-methylbutanoicacid | 625-05-8 | 2A-9079984 |
| 2-Amino-5-bromobenzenesulphonamide | 54734-84-8 | 2A-9079986 |
| Sulfanilylurea | 547-44-4 | 2A-9079987 |
| 3,5-Dichlorobenzotrifluoride | 54773-20-5 | 2A-9079988 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA