![[2-(4-Bromophenoxy)-ethyl]diethylamine structure, CAS 1823-62-7](/structures/80000/79971_1_1823_62_7.png)
CAS Number1823-62-7
Synonyms2-(4-Bromophenoxy)-N,N-diethylethanamine; 4-<2-(Diethylamino)ethoxy>phenyl bromide; 4-(2-(diethylamino)-ethoxy)-1-bromobenzene; 4-(2-Diethylaminoethyloxy)bromobenzene; 4-(2-(diethylamino)ethoxy)-benzenebromide; 4-[2-N,N-Diethylethoxy]phenylbromide; [2-(4-Bromo-phenoxy)-ethyl]-diethyl-amine; 4-(2-(diethylamino)ethoxy)bromobenzene
Molecular FormulaC12H15BrO3
Molecular Weight272.181
Density1.2±0.1 g/cm3
Boiling Point319.5±22.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1823-62-7 |
| Catalog No. | 2A-9079971 |
| Chinese Name | 2-(4-Bromophenoxy)-N,N-diethylethanamine |
| Synonyms | 2-(4-Bromophenoxy)-N,N-diethylethanamine; 4-<2-(Diethylamino)ethoxy>phenyl bromide; 4-(2-(diethylamino)-ethoxy)-1-bromobenzene; 4-(2-Diethylaminoethyloxy)bromobenzene; 4-(2-(diethylamino)ethoxy)-benzenebromide; 4-[2-N,N-Diethylethoxy]phenylbromide; [2-(4-Bromo-phenoxy)-ethyl]-diethyl-amine; 4-(2-(diethylamino)ethoxy)bromobenzene |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 272.181 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 319.5±22.0 °C at 760 mmHg |
| Appearance | solid |
| HTC | 2922299090 |
| PubChem ID | 3183642 |
| MDL Number | MFCD04054531 |
| SMILES | CCOC(C(C)(OC1=CC=C(Br)C=C1)C)=O |
| InChI | 1S/C12H15BrO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
| InChI Key | IOVDAUBZQSIHIQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352101 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Benzyl-N-phenyl-thiocarbamoylchloride | 24053-61-0 | 2A-9079962 |
| N,N-Dibenzylformamide | 5464-77-7 | 2A-9079964 |
| 4-Bromo-N-methylaniline | 211060-12-7 | 2A-9079965 |
| 4,6-Dihydroxynicotinicacid | 5466-62-6 | 2A-9079966 |
| 6-Chloro-2(3H)-benzothiazolone | 62266-81-3 | 2A-9079967 |
| N-(4-Bromophenyl)-N-methylthiocarbamoylchloride | 10219-03-1 | 2A-9079973 |
| 6,7-Dihydro-4H-pyrano[4,3-d]thiazol-2-aminehydrochloride | 623931-31-7 | 2A-9079974 |
| 3,4-Dibromoanisole | 62415-74-1 | 2A-9079976 |
| 2-Amino-4,6-diMethylNicotinonitrile | 5468-34-8 | 2A-9079977 |
| 3-Dimethylamino-2-isocyanoacrylicacidmethylester | 113212-14-9 | 2A-9079979 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA