
CAS Number43040-76-2
SynonymsBansyl Chloride; MFCD00059134; 5-(dibutylamino)naphthalene-1-sulfonyl chloride
Molecular FormulaC18H24ClNO2S
Molecular Weight353.90700
Density1.19g/cm3
Boiling Point449.2ºC at 760mmHg
AppearanceLiquid;Light yellow to Brown clear liquid to cloudy liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43040-76-2 |
| Catalog No. | 2A-9079932 |
| Chinese Name | 班磺酰氯 |
| Synonyms | Bansyl Chloride; MFCD00059134; 5-(dibutylamino)naphthalene-1-sulfonyl chloride |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.90700 |
| Density | 1.19g/cm3 |
| Boiling Point | 449.2ºC at 760mmHg |
| Appearance | Liquid;Light yellow to Brown clear liquid to cloudy liquid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2921199090 |
| PubChem ID | 3184947 |
| SMILES | CCCCN(CCCC)c1cccc2c(S(=O)(=O)Cl)cccc12 |
| InChI | InChI=1S/C18H24ClNO2S/c1-3-5-13-20(14-6-4-2)17-11-7-10-16-15(17)9-8-12-18(16)23(19,21)22/h7-12H,3-6,13-14H2,1-2H3 |
| InChI Key | PIZHBGYIKYGXBV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Chloro-4-dimethylaminoazobenzene | 2491-76-1 | 2A-9079924 |
| Cyclobutane-1,1-dicarboxylicacidethylester | 54450-84-9 | 2A-9079925 |
| N,N,N',N'-1,4-Phenylenediaminetetraaceticacid | 1099-02-1 | 2A-9079926 |
| 1,8-Phenylacidsodiumsalt | 1445-19-8 | 2A-9079927 |
| 2-Dimethylaminonaphthalene | 2436-85-3 | 2A-9079929 |
| 2-Chloro-6-methyl-5-nitropyrimidin-4-amine | 5453-06-5 | 2A-9079933 |
| 6-P-Toluidine-2-naphthalenesulfonicacid | 7724-15-4 | 2A-9079936 |
| 1-(7-Amino-3,4-dihydroquinolin-1(2H)-yl)ethanone | 545394-33-0 | 2A-9079937 |
| 4-(Dimethylamino)-1-naphthoicacid | 78062-03-0 | 2A-9079938 |
| P-Isopropoxydiphenylamine | 101-73-5 | 2A-9079939 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA