CAS Number543-87-3
Synonyms1-Butanol,3-methyl-,nitrate; isoamyl nitrate; 2-methyl-4-nitrooxybutane; EINECS 208-852-7; ISOPENTYL ALCOHOL,NITRATE; Nitrito d'amile [Italian]; MFCD00007042; Isopentyl nitrate; 3-Methyl-1-butanol nitrate; 3-methyl-1-butyl nitrate
Molecular FormulaC5H11NO3
Molecular Weight133.14600
Density1.00
Boiling Point148 °C
Melting Point<-60ºC
AppearanceColorless - almost colorless transparent liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 543-87-3 |
| Catalog No. | 2A-9079911 |
| Chinese Name | 硝酸异戊酯 |
| Synonyms | 1-Butanol,3-methyl-,nitrate; isoamyl nitrate; 2-methyl-4-nitrooxybutane; EINECS 208-852-7; ISOPENTYL ALCOHOL,NITRATE; Nitrito d'amile [Italian]; MFCD00007042; Isopentyl nitrate; 3-Methyl-1-butanol nitrate; 3-methyl-1-butyl nitrate |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.14600 |
| Density | 1.00 |
| Boiling Point | 148 °C |
| Melting Point | <-60ºC |
| Appearance | Colorless - almost colorless transparent liquid |
| Storage Condition | Store in a cool, dry, well-ventilated warehouse. K |
| Packaging | III |
| HTC | 2920909090 |
| PubChem ID | 8157994 |
| SMILES | CC(C)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO3/c1-5(2)3-4-9-6(7)8/h5H,3-4H2,1-2H3 |
| InChI Key | NTHGIYFSMNNHSC-UHFFFAOYSA-N |
| Hazard Symbols | 3.1 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1112 Official Shipping Name: Amyl Nitrate Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-5-nitrobenzamide | 54321-80-1 | 2A-9079902 |
| 4-Methanesulfonyl-benzamidinehydrochloride | 5434-06-0 | 2A-9079905 |
| 1,3-Dibromo-2,2-diMethylpropane | 5434-27-5 | 2A-9079906 |
| Ethyl-2-chlorophenylacetate | 40061-54-9 | 2A-9079907 |
| C-[3-(2-Fluoro-phenyl)-isoxazol-5-yl]-methylamine | 543713-33-3 | 2A-9079909 |
| Diisopentylamine | 544-00-3 | 2A-9079912 |
| 3-Amino-4-phenylbutan-2-onehydrochloride | 5440-27-7 | 2A-9079914 |
| N-(2-Aminoethyl)-4-piperidinol | 129999-60-6 | 2A-9079916 |
| 2'-Chloro-4-dimethylaminoazobenzene | 3010-47-7 | 2A-9079919 |
| 1-Cyclohexyl-Ethylamine | 54423-01-7 | 2A-9079920 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS