
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54198-89-9 |
| Catalog No. | 2A-9079882 |
| Chinese Name | 5-氯-2-甲基嘧啶 |
| Synonyms | 5-chloro-2-methyl-pyrimidine; 5-Chlor-2-methyl-pyrimidin |
| Molecular Formula | C5H5ClN2 |
| Molecular Weight | 128.56 |
| Density | 1.234 g/cm3 |
| Boiling Point | 169.3ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 439578 |
| SMILES | Cc1ncc(Cl)cn1 |
| InChI | InChI=1S/C5H5ClN2/c1-4-7-2-5(6)3-8-4/h2-3H,1H3 |
| InChI Key | UISREOKYJBBYSC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Chloro-5,6-dimethyl-1H-benzimidazole | 39791-96-3 | 2A-9079869 |
| 6-Chloro-1H-benzo[d]imidazole-2-carboxylicacid | 39811-14-8 | 2A-9079870 |
| 5-Nitro-1,2-benzisoxazole | 39835-28-4 | 2A-9079873 |
| 6-Chloro-2-Methyl-2H-indazole | 541539-87-1 | 2A-9079874 |
| Tert-butyl4-(2-nitrophenylamino)piperidine-1-carboxylate | 87120-73-8 | 2A-9079879 |
| 4-(3-Chloropyridin-2-yl)morpholine | 54231-36-6 | 2A-9079887 |
| 1-Cbz-2-(2-HydroxyEthyl)piperidine | 39945-50-1 | 2A-9079889 |
| 7-Fluoro-1H-indole-2-carboxylicacid | 399-67-7 | 2A-9079891 |
| 2-(4-Biphenyl)pyrrolidine | 5424-66-8 | 2A-9079892 |
| 3-Nitropyridine-2-sulfonicacid | 54247-50-6 | 2A-9079894 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA