
CAS Number3970-05-6
Synonyms4-chloro-2-aminomethylphenol; 5-chlorosalicylamine; RARECHEM AL BW 0871; 2-hydroxy-5-chlorobenzylamine; 5-chloro-2-hydroxybenzylamine; 2-aminomethyl-4-chloro-phenol
Molecular FormulaC7H8O1N1Cl1
Molecular Weight157.6
Density1.315g/cm3
Boiling Point280.6ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3970-05-6 |
| Catalog No. | 2A-9079856 |
| Chinese Name | 2-氨基甲基-4-氯苯酚 |
| Synonyms | 4-chloro-2-aminomethylphenol; 5-chlorosalicylamine; RARECHEM AL BW 0871; 2-hydroxy-5-chlorobenzylamine; 5-chloro-2-hydroxybenzylamine; 2-aminomethyl-4-chloro-phenol |
| Molecular Formula | C7H8O1N1Cl1 |
| Molecular Weight | 157.6 |
| Density | 1.315g/cm3 |
| Boiling Point | 280.6ºC at 760mmHg |
| HTC | 2922299090 |
| PubChem ID | 87081 |
| MDL Number | MFCD06212916 |
| SMILES | NCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C7H8ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H,4,9H2 |
| InChI Key | PTZMBOCHADEFMC-UHFFFAOYSA-N |
| MSDS | msds/79856_1_3970_05_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Piperazin-1-yl-indan-1-one | 868245-03-8 | 2A-9079841 |
| 3,3'-Diaminobenzidinetetrahydrochloridehydrate | 868272-85-9 | 2A-9079842 |
| 5-Bromo-2-methylbenzotrifluoride | 86845-27-4 | 2A-9079844 |
| 2-Bromoethoxy-t-butyldimethylsilane | 86864-60-0 | 2A-9079845 |
| 5-Amino-2-naphthol | 86-97-5 | 2A-9079850 |
| 4-Fluoro-2-methoxybenzylamine | 870563-60-3 | 2A-9079858 |
| 1-Bromo-2-chloro-3-nitrobenzene | 3970-37-4 | 2A-9079859 |
| 1-Bromo-3-tert-butylbenzene | 3972-64-3 | 2A-9079864 |
| 6-Phenyl-pyridin-2-ylamine | 39774-25-9 | 2A-9079867 |
| 2-Hydroxy-4-nitrobenzonitrile | 39835-14-8 | 2A-9079871 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA