![4-Methyl-1-[4-(trifluoromethyl)phenyl]pentan-1-one structure, CAS 869318-90-1](/structures/80000/79848_1_869318_90_1.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 869318-90-1 |
| Catalog No. | 2A-9079848 |
| Chinese Name | 4-甲基-1-[4-(三氟甲基)苯基]-1-戊酮 |
| Synonyms | 4-methyl-1-(4-(trifluoromethyl)phenyl)pentan-1-one; I01-8700 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 276.27 |
| Purity | 95 |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 99450294 |
| SMILES | CC(C)CCC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O/c1-9(2)3-8-12(17)10-4-6-11(7-5-10)13(14,15)16/h4-7,9H,3,8H2,1-2H3 |
| InChI Key | ROHCWUUJCPYTBZ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352200 |
| MSDS | msds/79848_1_869318_90_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-(2-Morpholinoethyl)-1H-pyrazole-4-boronicacidpinacolester | 864754-18-7 | 2A-9079830 |
| 3-Fluoro-4-trifluoromethyl-phenylboronicacid | 864759-68-2 | 2A-9079831 |
| Tert-Butyldimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-enyloxy)silane | 865869-27-8 | 2A-9079834 |
| 2-Benzyl-2,8-diazaspiro[4.5]decane | 867009-61-8 | 2A-9079839 |
| (1S)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentylamine | 869318-89-8 | 2A-9079847 |
| 6-Isopropoxypyridine-3-boronicacid | 870521-30-5 | 2A-9079857 |
| Indole-3-boronicacidpinacolester | 870717-93-4 | 2A-9079862 |
| 2-(2'-Chlorobenzyloxy)phenylboronicacid | 870777-21-2 | 2A-9079863 |
| 2-Benzyl-2,7-diaza-spiro[4.4]nonane | 54329-49-6 | 2A-9079904 |
| BETA-Styrylboronicaciddiethanolamineester | 411222-52-1 | 2A-9079931 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA