
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39250-90-3 |
| Catalog No. | 2A-9079796 |
| Chinese Name | 3,5-二甲基-4-甲氧基苯甲醛 |
| Synonyms | VHR C1 E1 DO1; 3,5-Dimethyl-p-anisaldehyde; MFCD02261755; 4-Methoxy-3,5-dimethylbenzaldehyde |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.201 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 264.0±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2912499000 |
| PubChem ID | 3185626 |
| SMILES | COc1c(C)cc(C=O)cc1C |
| InChI | InChI=1S/C10H12O2/c1-7-4-9(6-11)5-8(2)10(7)12-3/h4-6H,1-3H3 |
| InChI Key | SNIGEINPLSDHBQ-UHFFFAOYSA-N |
| MSDS | msds/79796_1_39250_90_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Benzyloxycarbonyl-5-nitrophenylboronicacid | 380430-62-6 | 2A-9079740 |
| 4-Chlorobenzenecarbaldehydeoxime | 3848-36-0 | 2A-9079762 |
| 2-Nitro-3-(trifluoromethyl)benzenamine | 386-71-0 | 2A-9079770 |
| 4-(Piperidine-1-carbonyl)phenylboronicacid | 389621-83-4 | 2A-9079782 |
| Thiazole-2-boronicacid | 389630-95-9 | 2A-9079783 |
| 3-Bromo-4-chlorobenzaldehyde | 86265-88-5 | 2A-9079820 |
| Pyridazine-4-boronicacidpinacolester | 863422-41-7 | 2A-9079824 |
| 2-Ethoxy-5-fluorophenylboronicacid | 864301-27-9 | 2A-9079827 |
| 1-(2-Morpholinoethyl)-1H-pyrazole-4-boronicacidpinacolester | 864754-18-7 | 2A-9079830 |
| 3-Fluoro-4-trifluoromethyl-phenylboronicacid | 864759-68-2 | 2A-9079831 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA