
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37934-89-7 |
| Catalog No. | 2A-9079730 |
| Chinese Name | 2,6-二甲基-4-甲氧基苯甲酸 |
| Synonyms | 4-Methoxy-2,6-dimethylbenzoic acid |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 310.0±37.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 3177238 |
| MDL Number | MFCD01194287 |
| SMILES | COc1cc(C)c(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C10H12O3/c1-6-4-8(13-3)5-7(2)9(6)10(11)12/h4-5H,1-3H3,(H,11,12) |
| InChI Key | GFWRERVOFRPXKB-UHFFFAOYSA-N |
| MSDS | msds/79730_1_37934_89_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Beta-(4-Chlorophenyl)glutaricanhydride | 53911-68-5 | 2A-9079714 |
| Benzyl3-oxobutanoate | 5396-89-4 | 2A-9079719 |
| 2-(3-Methyl-1H-pyrazol-5-yl)ethanamine | 54055-40-2 | 2A-9079726 |
| Ethyl2-(tert-butylamino)acetate | 37885-76-0 | 2A-9079727 |
| Trans1-Chloro-3-(2-nitrovinyl)benzene | 37888-03-2 | 2A-9079728 |
| Glycinet-butylesteraceticacid | 38024-18-9 | 2A-9079734 |
| 5,6,7,8-Tetrahydro-1,8-naphthyridin-2-butylamine | 380394-88-7 | 2A-9079735 |
| 2-Hydroxynaphthalene-1-carbonylchloride | 38077-75-7 | 2A-9079741 |
| Methyl5-bromo-6-hydroxynicotinate | 381247-99-0 | 2A-9079743 |
| 2-Aminocycloheptanecarboxylicacid | 3814-46-8 | 2A-9079744 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA