
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52500-61-5 |
| Catalog No. | 2A-9079705 |
| Chinese Name | 1-氨基-1-苯基丙-2-醇 |
| Synonyms | 1-Phenyl-2-hydroxypropylamine; S01-0697 |
| Molecular Formula | C9H13O1N1 |
| Molecular Weight | 151.21 |
| Density | 1.071g/cm3 |
| Boiling Point | 288.1ºC at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2922199090 |
| PubChem ID | 37387351 |
| MDL Number | MFCD11213424 |
| SMILES | CC(O)C(N)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-7(11)9(10)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| InChI Key | AAEOXZIUGCXWTF-UHFFFAOYSA-N |
| MSDS | msds/79705_1_52500_61_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-(4-(Bromomethyl)phenyl)ethanone | 51229-51-7 | 2A-9079622 |
| Phenylboronicacid,neopentylester | 5123-13-7 | 2A-9079623 |
| 2-Methyl-4-methoxybenzaldehyde | 52289-54-0 | 2A-9079689 |
| 1-(Bromomethyl)-2-methoxybenzene | 52289-93-7 | 2A-9079690 |
| 5-Ethyl-2-hydroxybenzenecarbaldehyde | 52411-35-5 | 2A-9079697 |
| 3-Chloro-5-(trifluoromethyl)benzoicacid | 53985-49-2 | 2A-9079720 |
| 3-Benzyloxycarbonylphenylboronicacid | 380430-52-4 | 2A-9079737 |
| 2-Amino-4-methoxycarbonylphenylboronicacidhydrochloride | 380430-55-7 | 2A-9079738 |
| N-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanesulfonamide | 380430-60-4 | 2A-9079739 |
| 3-Benzyloxycarbonyl-5-nitrophenylboronicacid | 380430-62-6 | 2A-9079740 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA