
CAS Number29682-41-5
Synonyms2,5-Dichloroiodobenzene; 2,5-dichloro-iodobenzene; 1,4-dichloro-6-iodobenzene; MFCD00001036; 2,5-Dichloro-1-iodobenzene; 1,4-dichloro-2-iodo-benzene; 1,4-Dichlor-2-jod-benzol; Benzene,1,4-dichloro-2-iodo; EINECS 249-774-3; 1,4-Dichloro-2-iodobenzene
Molecular FormulaC6H3Cl2I
Molecular Weight272.898
Purity98%
Density2.0±0.1 g/cm3
Boiling Point255.5±0.0 °C at 760 mmHg
Melting Point21 °C(lit.)
AppearanceColorless to golden liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29682-41-5 |
| Catalog No. | 2A-9000797 |
| Chinese Name | 1,4-二氯-2-碘苯 |
| Synonyms | 2,5-Dichloroiodobenzene; 2,5-dichloro-iodobenzene; 1,4-dichloro-6-iodobenzene; MFCD00001036; 2,5-Dichloro-1-iodobenzene; 1,4-dichloro-2-iodo-benzene; 1,4-Dichlor-2-jod-benzol; Benzene,1,4-dichloro-2-iodo; EINECS 249-774-3; 1,4-Dichloro-2-iodobenzene |
| Molecular Formula | C6H3Cl2I |
| Molecular Weight | 272.898 |
| Purity | 98 |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 255.5±0.0 °C at 760 mmHg |
| Melting Point | 21 °C(lit.) |
| Appearance | Colorless to golden liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2903999090 |
| SMILES | Clc1ccc(Cl)c(I)c1 |
| InChI | InChI=1S/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChI Key | SBHVNORGKIPGCL-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | 36/37/38 |
| Safety Description | 26-37/39 |
| MSDS | msds/797_1_29682_41_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 1,4-Dichloro-2-iodobenzene Modification number: 2 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,4-Dibromo-2,5-dimethoxybenzene | 2674-34-2 | 2A-9000792 |
| 1,4-Dibromo-2-fluorobenzene | 1435-52-5 | 2A-9000793 |
| 1,4-Dibromobut-2-ene | 6974-12-5 | 2A-9000794 |
| 1,4-Dibromohexafluorobut-2-ene | 360-87-2 | 2A-9000795 |
| 1,4-Dibromoperfluorobutane | 335-48-8 | 2A-9000796 |
| 1,4-Dicyano-2-(trifluoromethoxy)benzene | 175278-16-7 | 2A-9000799 |
| 1,4-Dicyano-2-ethylbenzene | 175278-32-7 | 2A-9000800 |
| 1,4-Difluoro-2-methyl-5-nitrobenzene | 141412-60-4 | 2A-9000801 |
| 1,4-Difluorobenzene | 540-36-3 | 2A-9000802 |
| 1,4-Diiodobenzene | 624-38-4 | 2A-0200601 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA