
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50878-90-5 |
| Catalog No. | 2A-9079601 |
| Chinese Name | 3-氨基-4-甲基喹啉 |
| Synonyms | 3-Amino-4-methylchinolin; 4-methyl-quinolin-3-ylamine; 3-AMINO-4-METHYLQUINOLINE; 4-methyl-[3]quinolylamine; 4-Methyl-[3]chinolylamin |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.205 |
| Density | 1.169g/cm3 |
| Boiling Point | 324ºC at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2933499090 |
| PubChem ID | 6395844 |
| MDL Number | MFCD02666056 |
| SMILES | Cc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2/c1-7-8-4-2-3-5-10(8)12-6-9(7)11/h2-6H,11H2,1H3 |
| InChI Key | HANMWNJJOSJZHD-UHFFFAOYSA-N |
| MSDS | msds/79601_1_50878_90_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Methyl5-bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylate | 50593-91-4 | 2A-9079584 |
| Methylpiperazine-1-carboxylate | 50606-31-0 | 2A-9079586 |
| 1-Methylpiperidine-4-carbaldehyde | 50675-21-3 | 2A-0201145 |
| 1-Benzofuran-5-ylmethylamine | 37798-08-6 | 2A-9079596 |
| 5-Methylpyrazine-2-carbaldehyde | 50866-30-3 | 2A-9079600 |
| 2-Methyl-1H-indole-3-carbonitrile | 51072-83-4 | 2A-9079610 |
| (3,5-Dibromo-4-methoxyphenyl)(2-Ethyl-3-benzofuranyl)-methanone | 51073-13-3 | 2A-9079611 |
| 6-Bromo-1,2,3,4-tetrahydro-quinoline-2-carboxylicacidmethylester | 511230-72-1 | 2A-9079615 |
| Methyl3-bromopyrazine-2-carboxylate | 51171-02-9 | 2A-9079618 |
| 4-Cyano-4-phenylpiperidinehydrochloride | 51304-58-6 | 2A-9079625 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA