
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5053-63-4 |
| Catalog No. | 2A-9079578 |
| Chinese Name | 3-氨基-1-苯基丙烷-1-醇 |
| Synonyms | 3-Phenyl-3-hydroxypropylamine |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 |
| Density | 1.074g/cm3 |
| Boiling Point | 293ºC at 760 mmHg |
| Melting Point | 50-53ºC |
| Appearance | solid |
| Storage Condition | -20°C Freezer |
| HTC | 2922199090 |
| PubChem ID | 7471697 |
| SMILES | NCCC(O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5,9,11H,6-7,10H2 |
| InChI Key | PHIYHIOQVWTXII-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trimethylsulfoxoniumchloride | 5034-06-0 | 2A-9079568 |
| 1-Pyridin-3-yl-cyclopropylamine | 503417-38-7 | 2A-9079569 |
| 2-Amino-2-(2-nitrophenyl)aceticacid | 50381-53-8 | 2A-9079574 |
| 6-Fluoro-2-naphthoicacid | 5043-01-6 | 2A-9079575 |
| 4-(2-Pyridinyl)-4-piperidinol | 50461-56-8 | 2A-9079576 |
| Thiodiglycolicacid | 505-73-7 | 2A-9079580 |
| 5-Fluoro-2-nitrobenzonitrile | 50594-78-0 | 2A-9079585 |
| 4-Bromo-2-chloroanisole | 50638-47-6 | 2A-9079588 |
| 4-Cyanomethylbenzoicacid | 50685-26-2 | 2A-9079590 |
| 5-Chloro-2-methylbenzonitrile | 50712-70-4 | 2A-9079591 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA