
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2010-61-9 |
| Catalog No. | 2A-9007957 |
| Chinese Name | 六氟-2-(对甲苯基)异丙醇 |
| Synonyms | Hexafluoro-2-(p-Tolyl)-2-Propanol; EINECS 217-928-9; 1,1,1,3,3,3-hexafluoro-2-p-tolylpropan-2-ol; MFCD00015357 |
| Molecular Formula | C9H8BrF6NO |
| Molecular Weight | 340.065 |
| Purity | 95 |
| Density | 1.25 g/cm3 |
| Boiling Point | 181ºC |
| Appearance | liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2903999090 |
| MDL Number | MFCD03931650 |
| SMILES | Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6O/c1-6-2-4-7(5-3-6)8(17,9(11,12)13)10(14,15)16/h2-5,17H,1H3 |
| InChI Key | AOAVZPXKNQAALI-UHFFFAOYSA-N |
| MSDS | msds/7957_1_2010_61_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Hesperetin | 520-33-2 | 2A-9007948 |
| Hex-5-ynoyl chloride | 2A-107950 | 2A-9007950 |
| Hexadecafluoro-1,8-diiodooctane | 335-70-6 | 2A-9007953 |
| Hexadecafluorosebacic acid | 307-78-8 | 2A-9007954 |
| Hexadecyl pyridinium chloride | 123-03-5 | 2A-9007956 |
| Hexafluoro-2-methylisopropanol | 1515-14-6 | 2A-9007959 |
| Hexafluoro-2-methylisopropyl acrylate | 53038-41-8 | 2A-9007960 |
| Hexafluoroglutaric acid | 376-73-8 | 2A-9007963 |
| Hexafluoroglutaric anhydride | 376-68-1 | 2A-9007964 |
| Hexafluoroisopropyl-2-fluoroacrylate | 74359-06-1 | 2A-9007966 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA