
CAS Number494799-17-6
Synonyms3-Cyclohexylindole-6-carboxylic acid; 1H-Indole-6-carboxylic acid,3-cyclohexyl; 3-cyclohexyl-6-indole carboxylic acid; 3-cyclohexyl-1H-indole-6-carboxylicacid; 3-Cyclohexyl-1H-indole-6-carboxylic acid
Molecular FormulaC15H17O2N1
Molecular Weight243.31
Density1.2±0.1 g/cm3
Boiling Point486.3±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 494799-17-6 |
| Catalog No. | 2A-9079535 |
| Chinese Name | 3-环己烷吲哚-6-甲酸 |
| Synonyms | 3-Cyclohexylindole-6-carboxylic acid; 1H-Indole-6-carboxylic acid,3-cyclohexyl; 3-cyclohexyl-6-indole carboxylic acid; 3-cyclohexyl-1H-indole-6-carboxylicacid; 3-Cyclohexyl-1H-indole-6-carboxylic acid |
| Molecular Formula | C15H17O2N1 |
| Molecular Weight | 243.31 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 486.3±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 16326365 |
| MDL Number | MFCD09833286 |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c[nH]c2c1 |
| InChI | InChI=1S/C15H17NO2/c17-15(18)11-6-7-12-13(9-16-14(12)8-11)10-4-2-1-3-5-10/h6-10,16H,1-5H2,(H,17,18) |
| InChI Key | OZJSQVKDKOOQIT-UHFFFAOYSA-N |
| MSDS | msds/79535_1_494799_17_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3H-Pyrido(3,4-b)indole,4,9-dihydro- | 4894-26-2 | 2A-9079524 |
| 4-Pyridinesulfonylchloridehydrochloride | 489430-50-4 | 2A-9079525 |
| 2,5-Dibromo-3-methoxypyrazine | 489431-66-5 | 2A-9079526 |
| 3-Amino-5-Methyl-4H-1,2,4-triazole | 4923-01-7 | 2A-9079532 |
| 2,3-Pyrazinedicarboxamide | 6164-78-9 | 2A-9079534 |
| 1-Ethylpiperidine-2-carboxylicacidhydrochloride | 49538-43-4 | 2A-9079536 |
| 2,3-Dihydro-1H-pyrrolo[3,4-c]pyridine | 496-13-9 | 2A-9079538 |
| 7-Bromo-2-methylquinoline | 4965-34-8 | 2A-9079539 |
| 3,3-Difluoropiperidinehydrochloride | 496807-97-7 | 2A-9079543 |
| 4-Benzyloxypyridine | 49826-70-2 | 2A-9079547 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA