
CAS Number53606-06-7
Synonyms1-(Bromomethyl)-4-(methylsulfonyl)benzene; 4-(Bromomethyl)phenyl methyl sulfone; 4-Methylsulphonylbenzyl bromide; 1-(bromomethyl)-4-methylsulfonylbenzene; MFCD00185849; 4-(Methylsulfonyl)benzyl bromide
Molecular FormulaC8H9BrO2S
Molecular Weight265.12
Density1.550
Boiling Point375.2±34.0 °C at 760 mmHg
Melting Point95-96 ºC
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53606-06-7 |
| Catalog No. | 2A-9079463 |
| Chinese Name | 4-甲基磺酰苄溴 |
| Synonyms | 1-(Bromomethyl)-4-(methylsulfonyl)benzene; 4-(Bromomethyl)phenyl methyl sulfone; 4-Methylsulphonylbenzyl bromide; 1-(bromomethyl)-4-methylsulfonylbenzene; MFCD00185849; 4-(Methylsulfonyl)benzyl bromide |
| Molecular Formula | C8H9BrO2S |
| Molecular Weight | 265.12 |
| Density | 1.550 |
| Boiling Point | 375.2±34.0 °C at 760 mmHg |
| Melting Point | 95-96 ºC |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2904909090 |
| PubChem ID | 329830277 |
| MDL Number | MFCD00185849 |
| SMILES | CS(C1=CC=C(CBr)C=C1)(=O)=O |
| InChI | 1S/C8H9BrO2S/c1-12(10,11)8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| InChI Key | HGKPAXHJTMHWAH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Hazard Symbols | Category 8 |
| MSDS | msds/79463_1_53606_06_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-Methoxypyridin-2-ylboronicacid | 372963-51-4 | 2A-9079330 |
| Benzopyrazine-6-boronicacidhydrochloride | 852362-25-5 | 2A-9079331 |
| 7,10-Dioxadispiro[2.2.4.2]dodecane | 52875-47-5 | 2A-9079364 |
| 5-Fluoro-6-methoxypyridine-3-boronicacid | 856250-60-7 | 2A-9079373 |
| (4-EthoxycarbonylMethylphenyl)boronicacidpinacolester | 859169-20-3 | 2A-9079395 |
| 2-Chloro-6-Methylpyridin-3-ylboronicacid | 536693-95-5 | 2A-9079468 |
| 3-Fluoro-4-isopropoxyphenylboronicacid | 480438-54-8 | 2A-9079498 |
| 3-Chloro-4-isopropoxyphenylboronicacid | 480438-56-0 | 2A-9079499 |
| 2-Butoxy-5-Methylphenylboronicacid | 480438-72-0 | 2A-9079500 |
| 4'-Bromo-4-biphenylboronicacid | 480996-05-2 | 2A-9079502 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA