
CAS Number559-91-1
Synonymsphenyl perfluoropropyl ketone; Heptafluorobutyrophenone; MFCD00077552; 1,1,2,2,3,3,3-heptafluorobutyrophenone; 1,1,2,2,3,3-heptafluorobutyrophenone; 2,2,3,3,4,4,4-heptafluorobutyrophenone; phenyl heptafluoropropyl ketone
Molecular FormulaC10H5F7O
Molecular Weight274.13500
Purity95%
Density1,473 g/cm3
Boiling Point170 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 559-91-1 |
| Catalog No. | 2A-9007944 |
| Chinese Name | (七氟丁偶基)苯酮 |
| Synonyms | phenyl perfluoropropyl ketone; Heptafluorobutyrophenone; MFCD00077552; 1,1,2,2,3,3,3-heptafluorobutyrophenone; 1,1,2,2,3,3-heptafluorobutyrophenone; 2,2,3,3,4,4,4-heptafluorobutyrophenone; phenyl heptafluoropropyl ketone |
| Molecular Formula | C10H5F7O |
| Molecular Weight | 274.13500 |
| Purity | 95 |
| Density | 1,473 g/cm3 |
| Boiling Point | 170 °C |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2914700090 |
| SMILES | O=C(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F7O/c11-8(12,9(13,14)10(15,16)17)7(18)6-4-2-1-3-5-6/h1-5H |
| InChI Key | UKYZDGAVBNKBPQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| H-D-Typ-OH | 153-94-6 | 2A-9007936 |
| Heptadecafluorononanoic acid | 375-95-1 | 2A-9007938 |
| Heptafluorobenzyl iodide | 79865-03-5 | 2A-9007940 |
| Heptafluorobutyrylamidine | 375-19-9 | 2A-9007941 |
| Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether | 3330-15-2 | 2A-9007943 |
| Heptafluoropropyltrifluorovinyl ether | 1623-05-8 | 2A-9007945 |
| Heptylnaphthalen-1-yl amine | 2A-107947 | 2A-9007947 |
| Hesperetin | 520-33-2 | 2A-9007948 |
| Hex-5-ynoyl chloride | 2A-107950 | 2A-9007950 |
| Hexadecafluoro-1,8-diiodooctane | 335-70-6 | 2A-9007953 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA